Difference between revisions of "R369"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-380 CPD-380] == * smiles: ** C(=O)([O-])C(=O)CS(=O)(=O)[O-] * inchi key: ** InChIKey=BUTHMS...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17917 RXN-17917] == * direction: ** LEFT-TO-RIGHT * common name: ** dna_ligase ** dna_ligase_mr...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17917 RXN-17917] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** dna_ligase |
| − | * | + | ** dna_ligase_mrna_capping_enzyme |
| − | ** | + | ** ORF |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | == | + | ** 1 [[DNA-Ligase-L-lysine]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[DNA-Ligase-L-lysine-adenylate]][c] |
| − | * [[ | + | * With common name(s): |
| + | ** 1 a [DNA ligase]-L-lysine[c] '''+''' 1 ATP[c] '''=>''' 1 diphosphate[c] '''+''' 1 H+[c] '''+''' 1 a [DNA ligase]-N6-(5'-adenylyl)-L-lysine[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_14250]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | * Gene: [[Tiso_gene_6743]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | * Gene: [[Tiso_gene_3498]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | * Gene: [[Tiso_gene_11251]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | * Gene: [[Tiso_gene_14249]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | * Gene: [[Tiso_gene_12142]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=dna_ligase}} | |
| − | + | {{#set: common name=dna_ligase_mrna_capping_enzyme}} | |
| − | + | {{#set: common name=ORF}} | |
| − | + | {{#set: gene associated=Tiso_gene_14250|Tiso_gene_6743|Tiso_gene_3498|Tiso_gene_11251|Tiso_gene_14249|Tiso_gene_12142}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 15:58, 21 March 2018
Contents
Reaction RXN-17917
- direction:
- LEFT-TO-RIGHT
- common name:
- dna_ligase
- dna_ligase_mrna_capping_enzyme
- ORF
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 DNA-Ligase-L-lysine[c] + 1 ATP[c] => 1 PPI[c] + 1 PROTON[c] + 1 DNA-Ligase-L-lysine-adenylate[c]
- With common name(s):
- 1 a [DNA ligase]-L-lysine[c] + 1 ATP[c] => 1 diphosphate[c] + 1 H+[c] + 1 a [DNA ligase]-N6-(5'-adenylyl)-L-lysine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14250
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_6743
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_3498
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_11251
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_14249
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_12142
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
