Difference between revisions of "Tiso gene 8816"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2750 CPD-2750] == * smiles: ** C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIK...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-20 RXN1F-20] == * direction: ** LEFT-TO-RIGHT * common name: ** Magnesium chelatase, H subuni...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2750 CPD-2750] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-20 RXN1F-20] ==
−
* smiles:
+
* direction:
−
** C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=XOKCJXZZNAUIQN-DTWKUNHWSA-N
+
 
* common name:
 
* common name:
−
** trans-3'-hydroxycotinine
+
** Magnesium chelatase, H subunit
−
* molecular weight:
+
** h_subunit_of_mg_chelatase
−
** 192.217   
+
** magnesium_chelatase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/6.6.1.1 EC-6.6.1.1]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN66-162]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[MG+2]][c] '''+''' 1 [[PROTOPORPHYRIN_IX]][c] '''+''' 1 [[ATP]][c] '''=>''' 3 [[PROTON]][c] '''+''' 1 [[MG-PROTOPORPHYRIN]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[Pi]][c]
−
* [[RXN66-161]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H2O[c] '''+''' 1 Mg2+[c] '''+''' 1 protoporphyrin IX[c] '''+''' 1 ATP[c] '''=>''' 3 H+[c] '''+''' 1 Mg-protoporphyrin[c] '''+''' 1 ADP[c] '''+''' 1 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_11960]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_5993]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_9870]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5531]], 3,8-divinyl-chlorophyllide a biosynthesis II (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5531 PWY-5531]
 +
** '''4''' reactions found over '''9''' reactions in the full pathway
 +
* [[CHLOROPHYLL-SYN]], 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent): [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-SYN CHLOROPHYLL-SYN]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
* [[PWY-7159]], 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7159 PWY-7159]
 +
** '''8''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=107963 107963]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13961 13961]
−
* CHEMSPIDER:
+
* LIGAND-RXN:
−
** [http://www.chemspider.com/Chemical-Structure.97080.html 97080]
+
** [http://www.genome.jp/dbget-bin/www_bget?R03877 R03877]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71182 71182]
+
{{#set: common name=Magnesium chelatase, H subunit}}
−
* METABOLIGHTS : MTBLC71182
+
{{#set: common name=h_subunit_of_mg_chelatase}}
−
* HMDB : HMDB01390
+
{{#set: common name=magnesium_chelatase}}
−
{{#set: smiles=C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2))}}
+
{{#set: ec number=EC-6.6.1.1}}
−
{{#set: inchi key=InChIKey=XOKCJXZZNAUIQN-DTWKUNHWSA-N}}
+
{{#set: gene associated=Tiso_gene_11960|Tiso_gene_5993|Tiso_gene_9870}}
−
{{#set: common name=trans-3'-hydroxycotinine}}
+
{{#set: in pathway=PWY-5531|CHLOROPHYLL-SYN|PWY-7159}}
−
{{#set: molecular weight=192.217    }}
+
{{#set: reconstruction category=orthology|manual|annotation}}
−
{{#set: consumed by=RXN66-162}}
+
{{#set: reconstruction source=annotation-experimental_annotation|orthology-athaliana|annotation-in-silico_annotation|manual-primary_network|orthology-esiliculosus}}
−
{{#set: produced by=RXN66-161}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}

Revision as of 15:58, 21 March 2018

Reaction RXN1F-20

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Magnesium chelatase, H subunit
    • h_subunit_of_mg_chelatase
    • magnesium_chelatase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5531, 3,8-divinyl-chlorophyllide a biosynthesis II (anaerobic): PWY-5531
    • 4 reactions found over 9 reactions in the full pathway
  • CHLOROPHYLL-SYN, 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent): CHLOROPHYLL-SYN
    • 9 reactions found over 9 reactions in the full pathway
  • PWY-7159, 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent): PWY-7159
    • 8 reactions found over 9 reactions in the full pathway

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8816&oldid=37754"