Difference between revisions of "Tiso gene 4596"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXY-L-PROLINE 4-HYDROXY-L-PROLINE] == * smiles: ** C1([N+]C(C(=O)[O-])CC(O)1) * inchi key...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14205 RXN-14205] == * direction: ** REVERSIBLE * common name: ** ORF * ec number: ** [http://en...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXY-L-PROLINE 4-HYDROXY-L-PROLINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14205 RXN-14205] ==
−
* smiles:
+
* direction:
−
** C1([N+]C(C(=O)[O-])CC(O)1)
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=PMMYEEVYMWASQN-DMTCNVIQSA-N
+
 
* common name:
 
* common name:
−
** trans-4-hydroxy-L-proline
+
** ORF
−
* molecular weight:
+
* ec number:
−
** 131.131   
+
** [http://enzyme.expasy.org/EC/3.6.1.5 EC-3.6.1.5]
 
* Synonym(s):
 
* Synonym(s):
−
** trans-4-hydroxyproline
 
−
** trans-oxyproline
 
−
** trans-L-4-hydroxyproline
 
−
** trans-hydroxy-L-proline
 
−
** trans-L-4-hydroxy-proline
 
−
** (2S,4R)-4-hydroxypyrrolidinium-2-carboxylate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RME144]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD0-1905]][c] '''+''' 2 [[WATER]][c] '''<=>''' 2 [[PROTON]][c] '''+''' 1 [[CPD-12365]][c] '''+''' 2 [[Pi]][c]
−
* [[RXN66-546]]
+
* With common name(s):
−
* [[RXN490-3641]]
+
** 1 8-oxo-dGTP[c] '''+''' 2 H2O[c] '''<=>''' 2 H+[c] '''+''' 1 8-oxo-dGMP[c] '''+''' 2 phosphate[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_20236]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_12899]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* NCI:
+
{{#set: direction=REVERSIBLE}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=46704 46704]
+
{{#set: common name=ORF}}
−
* CAS : 51-35-4
+
{{#set: ec number=EC-3.6.1.5}}
−
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_20236|Tiso_gene_12899}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971053 6971053]
+
{{#set: in pathway=}}
−
* HMDB : HMDB00725
+
{{#set: reconstruction category=orthology|annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58375 58375]
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
* METABOLIGHTS : MTBLC58375
+
−
{{#set: smiles=C1([N+]C(C(=O)[O-])CC(O)1)}}
+
−
{{#set: inchi key=InChIKey=PMMYEEVYMWASQN-DMTCNVIQSA-N}}
+
−
{{#set: common name=trans-4-hydroxy-L-proline}}
+
−
{{#set: molecular weight=131.131    }}
+
−
{{#set: common name=trans-4-hydroxyproline|trans-oxyproline|trans-L-4-hydroxyproline|trans-hydroxy-L-proline|trans-L-4-hydroxy-proline|(2S,4R)-4-hydroxypyrrolidinium-2-carboxylate}}
+
−
{{#set: consumed by=RME144}}
+
−
{{#set: produced by=RXN66-546|RXN490-3641}}
+

Revision as of 15:59, 21 March 2018

Reaction RXN-14205

  • direction:
    • REVERSIBLE
  • common name:
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 8-oxo-dGTP[c] + 2 H2O[c] <=> 2 H+[c] + 1 8-oxo-dGMP[c] + 2 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4596&oldid=37832"