Difference between revisions of "3-HYDROXYADIPYL-COA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_3718 == * left end position: ** 14575 * transcription direction: ** POSITIVE * right end position: ** 16010 * centisome position: ** 90.331...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_3718 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] ==
−
* left end position:
+
* smiles:
−
** 14575
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** campest-4-en-3-one
−
* right end position:
+
* inchi key:
−
** 16010
+
** InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N
−
* centisome position:
+
* molecular weight:
−
** 90.33158    
+
** 398.671    
 
* Synonym(s):
 
* Synonym(s):
 +
** methylcholestenone
 +
** (24R)-24-methyl-cholest-4-en-3-one
 +
** 3-dehydro-Δ4-5-campesterol
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[1.1.1.8-RXN]]
+
* [[RXN-711]]
−
** in-silico_annotation
+
* [[RXN-4231]]
−
***ec-number
+
== Reaction(s) known to produce the compound ==
−
** [[pantograph]]-[[esiliculosus]]
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[GLYC3PDEHYDROGBIOSYN-RXN]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways associated ==
+
−
* [[PWY-6118]]
+
−
* [[PWY-7385]]
+
−
* [[PWY-5981]]
+
−
* [[PWY-5667]]
+
−
* [[PWY0-1319]]
+
−
* [[PWY-7411]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=14575}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11988279 11988279]
−
{{#set: right end position=16010}}
+
* HMDB : HMDB12196
−
{{#set: centisome position=90.33158   }}
+
* LIGAND-CPD:
−
{{#set: reaction associated=1.1.1.8-RXN|GLYC3PDEHYDROGBIOSYN-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15785 C15785]
−
{{#set: pathway associated=PWY-6118|PWY-7385|PWY-5981|PWY-5667|PWY0-1319|PWY-7411}}
+
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=campest-4-en-3-one}}
 +
{{#set: inchi key=InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N}}
 +
{{#set: molecular weight=398.671   }}
 +
{{#set: common name=methylcholestenone|(24R)-24-methyl-cholest-4-en-3-one|3-dehydro-Δ4-5-campesterol}}
 +
{{#set: consumed by=RXN-711|RXN-4231}}

Revision as of 16:59, 21 March 2018

Metabolite CPD-698

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • campest-4-en-3-one
  • inchi key:
    • InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N
  • molecular weight:
    • 398.671
  • Synonym(s):
    • methylcholestenone
    • (24R)-24-methyl-cholest-4-en-3-one
    • 3-dehydro-Δ4-5-campesterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3-HYDROXYADIPYL-COA&oldid=37867"