Difference between revisions of "Tiso gene 7495"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_44 == * left end position: ** 11667 * transcription direction: ** POSITIVE * right end position: ** 19959 * centisome position: ** 23.77575...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_44 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] ==
−
* left end position:
+
* smiles:
−
** 11667
+
** C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** 2-hydroxy-dATP
−
* right end position:
+
* inchi key:
−
** 19959
+
** InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J
−
* centisome position:
+
* molecular weight:
−
** 23.775753    
+
** 503.152    
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-hydroxy-2'-deoxyadenosine 5'-triphosphate
 +
** 2'-deoxyisoguanosine triphosphate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN-14290]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=11667}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289402 86289402]
−
{{#set: right end position=19959}}
+
* CHEBI:
−
{{#set: centisome position=23.775753   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77897 77897]
−
{{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}}
+
{{#set: smiles=C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O}}
 +
{{#set: common name=2-hydroxy-dATP}}
 +
{{#set: inchi key=InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J}}
 +
{{#set: molecular weight=503.152   }}
 +
{{#set: common name=2-hydroxy-2'-deoxyadenosine 5'-triphosphate|2'-deoxyisoguanosine triphosphate}}
 +
{{#set: produced by=RXN-14290}}

Revision as of 16:01, 21 March 2018

Metabolite CPD-13851

  • smiles:
    • C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O
  • common name:
    • 2-hydroxy-dATP
  • inchi key:
    • InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J
  • molecular weight:
    • 503.152
  • Synonym(s):
    • 2-hydroxy-2'-deoxyadenosine 5'-triphosphate
    • 2'-deoxyisoguanosine triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_7495&oldid=38075"