Difference between revisions of "RXN1G-138"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_Pi TransportSeed_Pi] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Form...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7013 CPD-7013] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7013 CPD-7013] == |
| − | * | + | * smiles: |
| − | ** | + | ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C([CH]=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9)))) |
| + | * common name: | ||
| + | ** geranylgeranyl chlorophyll b | ||
| + | * molecular weight: | ||
| + | ** 901.439 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-7673]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | == | + | |
| − | * | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245917 25245917] |
| − | {{#set: | + | {{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C([CH]=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))}} |
| − | {{#set: | + | {{#set: common name=geranylgeranyl chlorophyll b}} |
| − | {{#set: | + | {{#set: molecular weight=901.439 }} |
| + | {{#set: reversible reaction associated=RXN-7673}} | ||
Revision as of 17:01, 21 March 2018
Contents
Metabolite CPD-7013
- smiles:
- C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C([CH]=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))
- common name:
- geranylgeranyl chlorophyll b
- molecular weight:
- 901.439
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C([CH]=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.
