Difference between revisions of "N-ACETYL-D-GLUCOSAMINE-6-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_342 == * Synonym(s): == Reactions associated == * NAD+-ADP-RIBOSYLTRANSFERASE-RXN ** in-silico_annotation ***ec-number == Pathways ass...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] == * smiles: ** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3)) * c...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_342 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] ==
 +
* smiles:
 +
** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3))
 +
* common name:
 +
** 3-O-methylkaempferol
 +
* inchi key:
 +
** InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 300.267   
 
* Synonym(s):
 
* Synonym(s):
 +
** kaempferol 3-methyl ether
 +
** 3-Methoxyapigenin
 +
** isokaempferide
 +
** 3-methylkaempferol
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
* [[RXN-13935]]
***ec-number
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280862 5280862]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1579 1579]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05902 C05902]
 +
{{#set: smiles=COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3))}}
 +
{{#set: common name=3-O-methylkaempferol}}
 +
{{#set: inchi key=InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=300.267    }}
 +
{{#set: common name=kaempferol 3-methyl ether|3-Methoxyapigenin|isokaempferide|3-methylkaempferol}}
 +
{{#set: produced by=RXN-13935}}

Revision as of 17:03, 21 March 2018

Metabolite CPD-14950

  • smiles:
    • COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3))
  • common name:
    • 3-O-methylkaempferol
  • inchi key:
    • InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N
  • molecular weight:
    • 300.267
  • Synonym(s):
    • kaempferol 3-methyl ether
    • 3-Methoxyapigenin
    • isokaempferide
    • 3-methylkaempferol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links