Difference between revisions of "Tiso gene 5047"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-521 RXN66-521] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] == * smiles: ** C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-521 RXN66-521] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)
 +
* common name:
 +
** XLLG xyloglucan oligosaccharide
 +
* inchi key:
 +
** InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N
 +
* molecular weight:
 +
** 1387.215   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-12400]]
** 1.0 [[ATP]][c] '''+''' 1.0 [[Glucopyranose]][c] '''=>''' 1.0 [[D-glucopyranose-6-phosphate]][c] '''+''' 1.0 [[ADP]][c] '''+''' 1.0 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1.0 ATP[c] '''+''' 1.0 D-glucopyranose[c] '''=>''' 1.0 D-glucopyranose 6-phosphate[c] '''+''' 1.0 ADP[c] '''+''' 1.0 H+[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_1303]]
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways  ==
+
== Reconstruction information  ==
+
* Category: [[orthology]]
+
** Source: [[orthology-esiliculosus]]
+
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: gene associated=Tiso_gene_1303}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940189 52940189]
{{#set: in pathway=}}
+
{{#set: smiles=C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)}}
{{#set: reconstruction category=orthology}}
+
{{#set: common name=XLLG xyloglucan oligosaccharide}}
{{#set: reconstruction source=orthology-esiliculosus}}
+
{{#set: inchi key=InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=1387.215    }}
 +
{{#set: consumed by=RXN-12400}}

Revision as of 16:03, 21 March 2018

Metabolite CPD-13378

  • smiles:
    • C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)
  • common name:
    • XLLG xyloglucan oligosaccharide
  • inchi key:
    • InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N
  • molecular weight:
    • 1387.215
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links