Difference between revisions of "Tiso gene 4337"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_8625 == * left end position: ** 125 * transcription direction: ** NEGATIVE * right end position: ** 2577 * centisome position: ** 1.2429154...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12045 CPD-12045] == * smiles: ** C(O)C1(C(O)C(O)C(O)O1) * common name: ** α-L-arabino...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_8625 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12045 CPD-12045] ==
−
* left end position:
+
* smiles:
−
** 125
+
** C(O)C1(C(O)C(O)C(O)O1)
−
* transcription direction:
+
* common name:
−
** NEGATIVE
+
** α-L-arabinofuranose
−
* right end position:
+
* inchi key:
−
** 2577
+
** InChIKey=HMFHBZSHGGEWLO-QMKXCQHVSA-N
−
* centisome position:
+
* molecular weight:
−
** 1.2429154    
+
** 150.131    
 
* Synonym(s):
 
* Synonym(s):
 +
** α-L-arabinose
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[PYRROLINECARBREDUCT-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[3.2.1.55-RXN]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
** experimental_annotation
+
−
***ec-number
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[R01251]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
* [[RXN66-546]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
** experimental_annotation
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[PWY-6344]]
+
−
* [[ARG-PRO-PWY]]
+
−
* [[PROSYN-PWY]]
+
−
* [[PWY-4981]]
+
−
* [[PWY-3341]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=125}}
+
* DRUGBANK : DB03142
−
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
−
{{#set: right end position=2577}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445935 445935]
−
{{#set: centisome position=1.2429154   }}
+
* CHEMSPIDER:
−
{{#set: reaction associated=PYRROLINECARBREDUCT-RXN|R01251|RXN66-546}}
+
** [http://www.chemspider.com/Chemical-Structure.393416.html 393416]
−
{{#set: pathway associated=PWY-6344|ARG-PRO-PWY|PROSYN-PWY|PWY-4981|PWY-3341}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28772 28772]
 +
{{#set: smiles=C(O)C1(C(O)C(O)C(O)O1)}}
 +
{{#set: common name=α-L-arabinofuranose}}
 +
{{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-QMKXCQHVSA-N}}
 +
{{#set: molecular weight=150.131   }}
 +
{{#set: common name=α-L-arabinose}}
 +
{{#set: produced by=3.2.1.55-RXN}}

Revision as of 16:05, 21 March 2018

Metabolite CPD-12045

  • smiles:
    • C(O)C1(C(O)C(O)C(O)O1)
  • common name:
    • α-L-arabinofuranose
  • inchi key:
    • InChIKey=HMFHBZSHGGEWLO-QMKXCQHVSA-N
  • molecular weight:
    • 150.131
  • Synonym(s):
    • α-L-arabinose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4337&oldid=38627"