Difference between revisions of "HOMOACONITATE-HYDRATASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_5749 == * left end position: ** 2525 * transcription direction: ** POSITIVE * right end position: ** 4260 * centisome position: ** 19.45300...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * smiles: ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) * common name: **...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_5749 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] ==
−
* left end position:
+
* smiles:
−
** 2525
+
** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** serotonin O-sulfate
−
* right end position:
+
* inchi key:
−
** 4260
+
** InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N
−
* centisome position:
+
* molecular weight:
−
** 19.453005    
+
** 256.276    
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-hydroxytryptamine O-sulfate
 +
** 3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate
 +
** 1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[5.99.1.2-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN-10777]]
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2525}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=152151 152151]
−
{{#set: right end position=4260}}
+
* CHEMSPIDER:
−
{{#set: centisome position=19.453005   }}
+
** [http://www.chemspider.com/Chemical-Structure.134104.html 134104]
−
{{#set: reaction associated=5.99.1.2-RXN}}
+
{{#set: smiles=C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))}}
 +
{{#set: common name=serotonin O-sulfate}}
 +
{{#set: inchi key=InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=256.276   }}
 +
{{#set: common name=5-hydroxytryptamine O-sulfate|3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate|1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)}}
 +
{{#set: produced by=RXN-10777}}

Revision as of 17:05, 21 March 2018

Metabolite CPD-11665

  • smiles:
    • C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))
  • common name:
    • serotonin O-sulfate
  • inchi key:
    • InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N
  • molecular weight:
    • 256.276
  • Synonym(s):
    • 5-hydroxytryptamine O-sulfate
    • 3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate
    • 1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=HOMOACONITATE-HYDRATASE-RXN&oldid=38694"