Difference between revisions of "3.2.1.37-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_5134 == * left end position: ** 11574 * transcription direction: ** POSITIVE * right end position: ** 13861 * centisome position: ** 83.488...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4586 CPD-4586] == * smiles: ** C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_5134 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4586 CPD-4586] ==
−
* left end position:
+
* smiles:
−
** 11574
+
** C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** dihydrodemethylsterigmatocystin
−
* right end position:
+
* inchi key:
−
** 13861
+
** InChIKey=WUSMTEDKVPWFDN-BWKAKNAASA-N
−
* centisome position:
+
* molecular weight:
−
** 83.48843    
+
** 312.278    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
+
* [[RXN-9500]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[PWY-7375]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=11574}}
+
* LIGAND-CPD:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C20444 C20444]
−
{{#set: right end position=13861}}
+
* CHEMSPIDER:
−
{{#set: centisome position=83.48843    }}
+
** [http://www.chemspider.com/Chemical-Structure.4588953.html 4588953]
−
{{#set: reaction associated=MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN}}
+
* PUBCHEM:
−
{{#set: pathway associated=PWY-7375}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20832874 20832874]
 +
* HMDB : HMDB33658
 +
{{#set: smiles=C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))}}
 +
{{#set: common name=dihydrodemethylsterigmatocystin}}
 +
{{#set: inchi key=InChIKey=WUSMTEDKVPWFDN-BWKAKNAASA-N}}
 +
{{#set: molecular weight=312.278    }}
 +
{{#set: consumed by=RXN-9500}}

Revision as of 16:07, 21 March 2018

Metabolite CPD-4586

  • smiles:
    • C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))
  • common name:
    • dihydrodemethylsterigmatocystin
  • inchi key:
    • InChIKey=WUSMTEDKVPWFDN-BWKAKNAASA-N
  • molecular weight:
    • 312.278
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3.2.1.37-RXN&oldid=38882"