Difference between revisions of "STRICTOSIDINE-SYNTHASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_1695 == * Synonym(s): == Reactions associated == * GLYCINE-AMINOTRANSFERASE-RXN ** pantograph-creinhardtii == Pathways associa...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-710 CPD-710] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CC...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_1695 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-710 CPD-710] ==
 +
* smiles:
 +
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* common name:
 +
** campestanol
 +
* inchi key:
 +
** InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N
 +
* molecular weight:
 +
** 402.702   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5α-campestanol
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
+
* [[RXN-773]]
** [[pantograph]]-[[creinhardtii]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-181]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=GLYCINE-AMINOTRANSFERASE-RXN}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-181}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119394 119394]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36799 36799]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15787 C15787]
 +
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=campestanol}}
 +
{{#set: inchi key=InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N}}
 +
{{#set: molecular weight=402.702    }}
 +
{{#set: common name=5α-campestanol}}
 +
{{#set: consumed by=RXN-773}}

Revision as of 17:08, 21 March 2018

Metabolite CPD-710

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • campestanol
  • inchi key:
    • InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N
  • molecular weight:
    • 402.702
  • Synonym(s):
    • 5α-campestanol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.