Difference between revisions of "Tiso gene 13200"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_13008 == * left end position: ** 69 * transcription direction: ** POSITIVE * right end position: ** 3050 * centisome position: ** 1.0487916...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-O-SINAPOYL-BETA-D-GLUCOSE 1-O-SINAPOYL-BETA-D-GLUCOSE] == * smiles: ** COC2(=CC(C=CC(=O)OC1(C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-O-SINAPOYL-BETA-D-GLUCOSE 1-O-SINAPOYL-BETA-D-GLUCOSE] == |
− | * | + | * smiles: |
− | ** | + | ** COC2(=CC(C=CC(=O)OC1(C(O)C(C(C(O1)CO)O)O))=CC(=C(O)2)OC) |
− | * | + | * common name: |
− | ** | + | ** 1-O-sinapoyl-β-D-glucose |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=XRKBRPFTFKKHEF-DGDBGZAXSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 386.355 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 1-O-sinapoyl β-D-glucoside | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[2.3.1.91-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280406 5280406] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4444086.html 4444086] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16546 16546] | ||
+ | * METABOLIGHTS : MTBLC16546 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01175 C01175] | ||
+ | {{#set: smiles=COC2(=CC(C=CC(=O)OC1(C(O)C(C(C(O1)CO)O)O))=CC(=C(O)2)OC)}} | ||
+ | {{#set: common name=1-O-sinapoyl-β-D-glucose}} | ||
+ | {{#set: inchi key=InChIKey=XRKBRPFTFKKHEF-DGDBGZAXSA-N}} | ||
+ | {{#set: molecular weight=386.355 }} | ||
+ | {{#set: common name=1-O-sinapoyl β-D-glucoside}} | ||
+ | {{#set: consumed by=2.3.1.91-RXN}} |
Revision as of 16:08, 21 March 2018
Contents
Metabolite 1-O-SINAPOYL-BETA-D-GLUCOSE
- smiles:
- COC2(=CC(C=CC(=O)OC1(C(O)C(C(C(O1)CO)O)O))=CC(=C(O)2)OC)
- common name:
- 1-O-sinapoyl-β-D-glucose
- inchi key:
- InChIKey=XRKBRPFTFKKHEF-DGDBGZAXSA-N
- molecular weight:
- 386.355
- Synonym(s):
- 1-O-sinapoyl β-D-glucoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links