Difference between revisions of "FARNESYL-PP"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_19451 == * left end position: ** 523 * transcription direction: ** NEGATIVE * right end position: ** 1719 * centisome position: ** 22.57229...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FARNESYL-PP FARNESYL-PP] == * smiles: ** CC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)[O-])(=O)[O-])C)C)C *...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FARNESYL-PP FARNESYL-PP] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)[O-])(=O)[O-])C)C)C |
− | * | + | * common name: |
− | ** | + | ** (2E,6E)-farnesyl diphosphate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=VWFJDQUYCIWHTN-YFVJMOTDSA-K |
− | * | + | * molecular weight: |
− | ** | + | ** 379.306 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-trans,6-trans-farnesyl diphosphate | ||
+ | ** FPP | ||
+ | ** trans, trans-farnesyl diphosphate | ||
+ | ** farnesyl-PP | ||
+ | ** farnesyl pyrophosphate | ||
+ | ** ω,E,E-farnesyl diphosphate | ||
+ | ** farnesyl diphosphate | ||
+ | ** (E,E)-farnesyl diphosphate | ||
+ | ** all-trans-farnesyl diphosphate | ||
+ | ** C15-PP | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | * [[RXN-8999]] |
− | + | * [[GGPS]] | |
− | + | * [[FARNESYLTRANSTRANSFERASE-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[FPPSYN-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[2.5.1.58-RXN]] | |
− | == | + | * [[RXN0-5180]] |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 13058-04-3 |
− | {{#set: | + | * BIGG : frdp |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15983959 15983959] |
− | {{#set: | + | * KNAPSACK : C00007268 |
− | {{#set: | + | * HMDB : HMDB00961 |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00448 C00448] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.11633047.html 11633047] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=175763 175763] | ||
+ | * METABOLIGHTS : MTBLC175763 | ||
+ | {{#set: smiles=CC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)[O-])(=O)[O-])C)C)C}} | ||
+ | {{#set: common name=(2E,6E)-farnesyl diphosphate}} | ||
+ | {{#set: inchi key=InChIKey=VWFJDQUYCIWHTN-YFVJMOTDSA-K}} | ||
+ | {{#set: molecular weight=379.306 }} | ||
+ | {{#set: common name=2-trans,6-trans-farnesyl diphosphate|FPP|trans, trans-farnesyl diphosphate|farnesyl-PP|farnesyl pyrophosphate|ω,E,E-farnesyl diphosphate|farnesyl diphosphate|(E,E)-farnesyl diphosphate|all-trans-farnesyl diphosphate|C15-PP}} | ||
+ | {{#set: consumed by=RXN-8999|GGPS|FARNESYLTRANSTRANSFERASE-RXN}} | ||
+ | {{#set: produced by=FPPSYN-RXN}} | ||
+ | {{#set: reversible reaction associated=2.5.1.58-RXN|RXN0-5180}} |
Latest revision as of 19:04, 21 March 2018
Contents
Metabolite FARNESYL-PP
- smiles:
- CC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)[O-])(=O)[O-])C)C)C
- common name:
- (2E,6E)-farnesyl diphosphate
- inchi key:
- InChIKey=VWFJDQUYCIWHTN-YFVJMOTDSA-K
- molecular weight:
- 379.306
- Synonym(s):
- 2-trans,6-trans-farnesyl diphosphate
- FPP
- trans, trans-farnesyl diphosphate
- farnesyl-PP
- farnesyl pyrophosphate
- ω,E,E-farnesyl diphosphate
- farnesyl diphosphate
- (E,E)-farnesyl diphosphate
- all-trans-farnesyl diphosphate
- C15-PP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 13058-04-3
- BIGG : frdp
- PUBCHEM:
- KNAPSACK : C00007268
- HMDB : HMDB00961
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC175763
"CC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)[O-])(=O)[O-])C)C)C" cannot be used as a page name in this wiki.