Difference between revisions of "Tiso gene 16254"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FARNESYL-PP FARNESYL-PP] == * smiles: ** CC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)[O-])(=O)[O-])C)C)C *...") |
(Created page with "Category:Gene == Gene Tiso_gene_16254 == * right end position: ** 1988 * transcription direction: ** POSITIVE * left end position: ** 765 * centisome position: ** 17.05685...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_16254 == |
− | * | + | * right end position: |
− | ** | + | ** 1988 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 765 |
− | * | + | * centisome position: |
− | ** | + | ** 17.056856 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN | + | * Reaction: [[DNA-DIRECTED-RNA-POLYMERASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * | + | *** Assignment: ec-number |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | * [[ | + | == Pathways associated == |
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=1988}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=765}} | |
− | + | {{#set: centisome position=17.056856 }} | |
− | + | {{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:04, 21 March 2018
Gene Tiso_gene_16254
- right end position:
- 1988
- transcription direction:
- POSITIVE
- left end position:
- 765
- centisome position:
- 17.056856
- Synonym(s):
Reactions associated
- Reaction: DNA-DIRECTED-RNA-POLYMERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation