Difference between revisions of "CPD-482"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=HEMESYN2-PWY HEMESYN2-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-475...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-482 CPD-482] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=HEMESYN2-PWY HEMESYN2-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-482 CPD-482] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33630 TAX-33630]
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
 
* common name:
 
* common name:
−
** heme biosynthesis II (anaerobic)
+
** gibberellin A51
 +
* inchi key:
 +
** InChIKey=HHDWSDSMWJQURA-GBNXXHSSSA-M
 +
* molecular weight:
 +
** 331.388   
 
* Synonym(s):
 
* Synonym(s):
 +
** GA51
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''3''' reactions found over '''4''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[HEMN-RXN]]
+
* [[RXN-171]]
−
** 5 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Tiso_gene_18066]]
+
−
*** [[Tiso_gene_13365]]
+
−
*** [[Tiso_gene_5577]]
+
−
*** [[Tiso_gene_13364]]
+
−
*** [[Tiso_gene_4004]]
+
−
** 4 reconstruction source(s) associated:
+
−
*** [[orthology-athaliana]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-synechocystis]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[PROTOHEMEFERROCHELAT-RXN]]
+
−
** 2 associated gene(s):
+
−
*** [[Tiso_gene_3284]]
+
−
*** [[Tiso_gene_15900]]
+
−
** 6 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-athaliana]]
+
−
*** [[orthology-synechocystis]]
+
−
*** [[orthology-creinhardtii]]
+
−
* [[UROGENDECARBOX-RXN]]
+
−
** 4 associated gene(s):
+
−
*** [[Tiso_gene_18743]]
+
−
*** [[Tiso_gene_19684]]
+
−
*** [[Tiso_gene_18744]]
+
−
*** [[Tiso_gene_5173]]
+
−
** 6 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-synechocystis]]
+
−
*** [[manual-primary_network]]
+
−
*** [[orthology-creinhardtii]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6259 RXN0-6259]
+
 
== External links  ==
 
== External links  ==
−
* ECOCYC:
+
* LIPID_MAPS : LMPR0104170022
−
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=HEMESYN2-PWY HEMESYN2-PWY]
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-4751}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245666 25245666]
−
{{#set: taxonomic range=TAX-33630}}
+
* HMDB : HMDB35041
−
{{#set: taxonomic range=TAX-2}}
+
* CHEBI:
−
{{#set: common name=heme biosynthesis II (anaerobic)}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29599 29599]
−
{{#set: reaction found=3}}
+
* LIGAND-CPD:
−
{{#set: total reaction=4}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11865 C11865]
−
{{#set: completion rate=75.0}}
+
{{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
 +
{{#set: common name=gibberellin A51}}
 +
{{#set: inchi key=InChIKey=HHDWSDSMWJQURA-GBNXXHSSSA-M}}
 +
{{#set: molecular weight=331.388    }}
 +
{{#set: common name=GA51}}
 +
{{#set: produced by=RXN-171}}

Latest revision as of 19:04, 21 March 2018

Metabolite CPD-482

  • smiles:
    • C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
  • common name:
    • gibberellin A51
  • inchi key:
    • InChIKey=HHDWSDSMWJQURA-GBNXXHSSSA-M
  • molecular weight:
    • 331.388
  • Synonym(s):
    • GA51

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • LIPID_MAPS : LMPR0104170022
  • PUBCHEM:
  • HMDB : HMDB35041
  • CHEBI:
  • LIGAND-CPD:
"C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-482&oldid=39312"