Difference between revisions of "CPD-482"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6385 RXN0-6385] == * direction: ** REVERSIBLE * common name: ** Thiosulfate/3-mercaptopyruvate...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-482 CPD-482] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6385 RXN0-6385] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-482 CPD-482] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
 
* common name:
 
* common name:
−
** Thiosulfate/3-mercaptopyruvate sulfurtransferase 1, mitochondrial
+
** gibberellin A51
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.8.1 EC-2.8.1]
+
** InChIKey=HHDWSDSMWJQURA-GBNXXHSSSA-M
 +
* molecular weight:
 +
** 331.388   
 
* Synonym(s):
 
* Synonym(s):
 +
** GA51
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Red-Thioredoxin]][c] '''+''' 1 [[S2O3]][c] '''<=>''' 1 [[SO3]][c] '''+''' 1 [[Ox-Thioredoxin]][c] '''+''' 1 [[HS]][c] '''+''' 1 [[PROTON]][c]
+
* [[RXN-171]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a reduced thioredoxin[c] '''+''' 1 thiosulfate[c] '''<=>''' 1 sulfite[c] '''+''' 1 an oxidized thioredoxin[c] '''+''' 1 hydrogen sulfide[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_5838]]
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* LIPID_MAPS : LMPR0104170022
−
{{#set: common name=Thiosulfate/3-mercaptopyruvate sulfurtransferase 1, mitochondrial}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.8.1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245666 25245666]
−
{{#set: gene associated=Tiso_gene_5838}}
+
* HMDB : HMDB35041
−
{{#set: in pathway=}}
+
* CHEBI:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29599 29599]
−
{{#set: reconstruction tool=pathwaytools}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=experimental_annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11865 C11865]
 +
{{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
 +
{{#set: common name=gibberellin A51}}
 +
{{#set: inchi key=InChIKey=HHDWSDSMWJQURA-GBNXXHSSSA-M}}
 +
{{#set: molecular weight=331.388    }}
 +
{{#set: common name=GA51}}
 +
{{#set: produced by=RXN-171}}

Latest revision as of 19:04, 21 March 2018

Metabolite CPD-482

  • smiles:
    • C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
  • common name:
    • gibberellin A51
  • inchi key:
    • InChIKey=HHDWSDSMWJQURA-GBNXXHSSSA-M
  • molecular weight:
    • 331.388
  • Synonym(s):
    • GA51

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • LIPID_MAPS : LMPR0104170022
  • PUBCHEM:
  • HMDB : HMDB35041
  • CHEBI:
  • LIGAND-CPD:
"C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-482&oldid=39312"