Difference between revisions of "24-2-N-linked-Glycan"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-723 CPD-723] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)C(O)CC(C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=24-2-N-linked-Glycan 24-2-N-linked-Glycan] == * common name: ** [(2,4),(2)]-N-linked glycan * S...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-723 CPD-723] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=24-2-N-linked-Glycan 24-2-N-linked-Glycan] ==
* smiles:
+
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))
+
* inchi key:
+
** InChIKey=VXBLCLVRWCLEOX-BFYSZXNBSA-N
+
 
* common name:
 
* common name:
** 6-deoxocastasterone
+
** [(2,4),(2)]-N-linked glycan
* molecular weight:
+
** 450.701   
+
 
* Synonym(s):
 
* Synonym(s):
** deoxocastasterone
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-778]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.4.1.145-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMST01030127
+
{{#set: common name=[(2,4),(2)]-N-linked glycan}}
* PUBCHEM:
+
{{#set: produced by=2.4.1.145-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13870433 13870433]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20712 20712]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C15802 C15802]
+
* HMDB : HMDB33984
+
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=VXBLCLVRWCLEOX-BFYSZXNBSA-N}}
+
{{#set: common name=6-deoxocastasterone}}
+
{{#set: molecular weight=450.701    }}
+
{{#set: common name=deoxocastasterone}}
+
{{#set: consumed by=RXN-778}}
+

Latest revision as of 19:05, 21 March 2018

Metabolite 24-2-N-linked-Glycan

  • common name:
    • [(2,4),(2)]-N-linked glycan
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"(2,4),(2)]-N-linked glycan" cannot be used as a page name in this wiki.