|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PRPPAMIDOTRANS-RXN PRPPAMIDOTRANS-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| * common name: | | * common name: |
− | ** ORF | + | ** 3-oxo-(7Z)-tetradecenoyl-CoA |
− | ** short-chain_dehydrogenase_reductase | + | * inchi key: |
− | * ec number: | + | ** InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J |
− | ** [http://enzyme.expasy.org/EC/2.4.2.14 EC-2.4.2.14] | + | * molecular weight: |
| + | ** 985.829 |
| * Synonym(s): | | * Synonym(s): |
| + | ** 3-oxo-14:1-Δ7-CoA |
| + | ** 3-oxo-7-cis-tetradecenoyl-CoA |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-17795]] |
− | ** 1 [[5-P-BETA-D-RIBOSYL-AMINE]][c] '''+''' 1 [[GLT]][c] '''+''' 1 [[PPI]][c] '''<=>''' 1 [[WATER]][c] '''+''' 1 [[PRPP]][c] '''+''' 1 [[GLN]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | * [[RXN-17794]] |
− | ** 1 5-phospho-β-D-ribosylamine[c] '''+''' 1 L-glutamate[c] '''+''' 1 diphosphate[c] '''<=>''' 1 H2O[c] '''+''' 1 5-phospho-α-D-ribose 1-diphosphate[c] '''+''' 1 L-glutamine[c]
| + | == Reaction(s) of unknown directionality == |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_1007]] | + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_9914]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | == Pathways == | + | |
− | * [[PWY-6121]], 5-aminoimidazole ribonucleotide biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6121 PWY-6121] | + | |
− | ** '''5''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-6122]], 5-aminoimidazole ribonucleotide biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6122 PWY-6122]
| + | |
− | ** '''4''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-7282]], 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7282 PWY-7282]
| + | |
− | ** '''6''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-6277]], superpathway of 5-aminoimidazole ribonucleotide biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6277 PWY-6277]
| + | |
− | ** '''6''' reactions found over '''9''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-athaliana]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-synechocystis]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[manual]]
| + | |
− | ** Source: [[manual-primary_network]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA:
| + | {{#set: smiles=CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14905 14905]
| + | {{#set: common name=3-oxo-(7Z)-tetradecenoyl-CoA}} |
− | * LIGAND-RXN:
| + | {{#set: inchi key=InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R01072 R01072]
| + | {{#set: molecular weight=985.829 }} |
− | * UNIPROT:
| + | {{#set: common name=3-oxo-14:1-Δ7-CoA|3-oxo-7-cis-tetradecenoyl-CoA}} |
− | ** [http://www.uniprot.org/uniprot/P28173 P28173]
| + | {{#set: consumed by=RXN-17795}} |
− | ** [http://www.uniprot.org/uniprot/P35433 P35433]
| + | {{#set: produced by=RXN-17794}} |
− | ** [http://www.uniprot.org/uniprot/Q06203 Q06203]
| + | |
− | ** [http://www.uniprot.org/uniprot/O29388 O29388]
| + | |
− | ** [http://www.uniprot.org/uniprot/O67236 O67236]
| + | |
− | ** [http://www.uniprot.org/uniprot/P65829 P65829]
| + | |
− | ** [http://www.uniprot.org/uniprot/O57979 O57979]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9X0X4 Q9X0X4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RXT6 Q9RXT6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9K0C4 Q9K0C4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9V253 Q9V253]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PIT3 Q9PIT3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q57657 Q57657]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JVC9 Q9JVC9]
| + | |
− | ** [http://www.uniprot.org/uniprot/O26742 O26742]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43854 P43854]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35853 P35853]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41390 P41390]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27601 Q27601]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q38999 Q38999]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04046 P04046]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q55621 Q55621]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q55038 Q55038]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9STG9 Q9STG9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9T0J5 Q9T0J5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52418 P52418]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52419 P52419]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q22134 Q22134]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZB05 Q9ZB05]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00497 P00497]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0AG16 P0AG16]
| + | |
− | {{#set: direction=REVERSIBLE}}
| + | |
− | {{#set: common name=ORF}} | + | |
− | {{#set: common name=short-chain_dehydrogenase_reductase}} | + | |
− | {{#set: ec number=EC-2.4.2.14}} | + | |
− | {{#set: gene associated=Tiso_gene_1007|Tiso_gene_9914}} | + | |
− | {{#set: in pathway=PWY-6121|PWY-6122|PWY-7282|PWY-6277}}
| + | |
− | {{#set: reconstruction category=orthology|manual|annotation}} | + | |
− | {{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis|manual-primary_network|orthology-creinhardtii}} | + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}}
| + | |