Difference between revisions of "PWY-621"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_ACETALDEHYDE INDOLE_ACETALDEHYDE] == * smiles: ** C(CC1(C2(=C(NC=1)C=CC=C2)))=O * inchi...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-621 PWY-621] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-621 PWY-621] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
* common name: | * common name: | ||
| − | ** | + | ** sucrose degradation III (sucrose invertase) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** sucrose mobilization |
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''4''' reactions found over '''4''' reactions in the full pathway |
| − | * [[RXN- | + | * [[3.2.1.48-RXN]] |
| − | + | ** 1 associated gene(s): | |
| − | == Reaction(s) | + | *** [[Tiso_gene_12644]] |
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | * [[FRUCTOKINASE-RXN]] | ||
| + | ** 3 associated gene(s): | ||
| + | *** [[Tiso_gene_1303]] | ||
| + | *** [[Tiso_gene_17974]] | ||
| + | *** [[Tiso_gene_3107]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | * [[GLUCOKIN-RXN]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Tiso_gene_3107]] | ||
| + | *** [[Tiso_gene_1303]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[PGLUCISOM-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_19480]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | * | + | * ARACYC: |
| − | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-621 PWY-621] | |
| − | ** [http:// | + | {{#set: taxonomic range=TAX-2157}} |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: common name=sucrose degradation III (sucrose invertase)}} | |
| − | + | {{#set: common name=sucrose mobilization}} | |
| − | + | {{#set: reaction found=4}} | |
| − | + | {{#set: total reaction=4}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:06, 21 March 2018
Pathway PWY-621
- taxonomic range:
- common name:
- sucrose degradation III (sucrose invertase)
- Synonym(s):
- sucrose mobilization
Reaction(s) found
4 reactions found over 4 reactions in the full pathway
- 3.2.1.48-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- FRUCTOKINASE-RXN
- 3 associated gene(s):
- 4 reconstruction source(s) associated:
- GLUCOKIN-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- PGLUCISOM-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC:
