Difference between revisions of "GAMA-TOCOPHEROL"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_5765 == * Synonym(s): == Reactions associated == * PROTEIN-KINASE-RXN ** pantograph-esiliculosus == Pathways associated == ==...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMA-TOCOPHEROL GAMA-TOCOPHEROL] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC1(C)(CCC2(=CC(O)=C(C)C(...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMA-TOCOPHEROL GAMA-TOCOPHEROL] == |
+ | * smiles: | ||
+ | ** CC(C)CCCC(C)CCCC(C)CCCC1(C)(CCC2(=CC(O)=C(C)C(=C(O1)2)C)) | ||
+ | * common name: | ||
+ | ** γ-tocopherol | ||
+ | * inchi key: | ||
+ | ** InChIKey=QUEDXNHFTDJVIY-DQCZWYHMSA-N | ||
+ | * molecular weight: | ||
+ | ** 416.686 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 7,8-dimethyltocol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92729 92729] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.83708.html 83708] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18185 18185] | ||
+ | * METABOLIGHTS : MTBLC18185 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C02483 C02483] | ||
+ | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC1(C)(CCC2(=CC(O)=C(C)C(=C(O1)2)C))}} | ||
+ | {{#set: common name=γ-tocopherol}} | ||
+ | {{#set: inchi key=InChIKey=QUEDXNHFTDJVIY-DQCZWYHMSA-N}} | ||
+ | {{#set: molecular weight=416.686 }} | ||
+ | {{#set: common name=7,8-dimethyltocol}} | ||
+ | {{#set: consumed by=TOCOPHEROL-O-METHYLTRANSFERASE-RXN}} |
Latest revision as of 19:06, 21 March 2018
Contents
Metabolite GAMA-TOCOPHEROL
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC1(C)(CCC2(=CC(O)=C(C)C(=C(O1)2)C))
- common name:
- γ-tocopherol
- inchi key:
- InChIKey=QUEDXNHFTDJVIY-DQCZWYHMSA-N
- molecular weight:
- 416.686
- Synonym(s):
- 7,8-dimethyltocol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links