Difference between revisions of "PWY66-3"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-BUTYRATE 4-AMINO-BUTYRATE] == * smiles: ** C(C[N+])CC([O-])=O * common name: ** 4-amino...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-3 PWY66-3] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-332...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-BUTYRATE 4-AMINO-BUTYRATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-3 PWY66-3] ==
−
* smiles:
+
* taxonomic range:
−
** C(C[N+])CC([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
 
* common name:
 
* common name:
−
** 4-aminobutanoate
+
** cholesterol biosynthesis II (via 24,25-dihydrolanosterol)
−
* inchi key:
+
−
** InChIKey=BTCSSZJGUNDROE-UHFFFAOYSA-N
+
−
* molecular weight:
+
−
** 103.121   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4-NH2-but
 
−
** 4-NH3-but
 
−
** GABA
 
−
** 4-aminobutyric acid
 
−
** γ-aminobutyrate
 
−
** 4-amino-n-butyric acid
 
−
** γ-amino-n-butyric acid
 
−
** gamma-amino-N-butyrate
 
−
** g-amino-n-butyric acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[TRANS-RXN-261]]
+
'''8''' reactions found over '''22''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[1.14.21.6-RXN]]
−
* [[ABor]]
+
** 1 associated gene(s):
−
* [[AMINOBUTDEHYDROG-RXN]]
+
*** [[Tiso_gene_5446]]
−
* [[GLUTDECARBOX-RXN]]
+
** 1 reconstruction source(s) associated:
−
* [[TRANS-RXN-261]]
+
*** [[orthology-esiliculosus]]
−
* [[GUANIDINOBUTYRASE-RXN]]
+
* [[RXN66-11]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
−
* [[GABATRANSAM-RXN]]
+
*** [[Tiso_gene_8263]]
−
* [[RXN-14209]]
+
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-12]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8263]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-13]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8263]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-14]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_10982]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-18]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_897]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-23]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_897]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-323]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8982]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5670 PWY-5670]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5670 PWY-5670]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6132 PWY-6132]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6132 PWY-6132]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-10 RXN66-10]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-15 RXN66-15]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-16 RXN66-16]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-17 RXN66-17]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-19 RXN66-19]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-20 RXN66-20]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-21 RXN66-21]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-22 RXN66-22]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-24 RXN66-24]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-25 RXN66-25]
 
== External links  ==
 
== External links  ==
−
* CAS : 56-12-2
+
{{#set: taxonomic range=TAX-33208}}
−
* BIGG : 4abut
+
{{#set: common name=cholesterol biosynthesis II (via 24,25-dihydrolanosterol)}}
−
* PUBCHEM:
+
{{#set: reaction found=8}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992099 6992099]
+
{{#set: total reaction=22}}
−
* HMDB : HMDB00112
+
{{#set: completion rate=36.0}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00334 C00334]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59888 59888]
+
−
* METABOLIGHTS : MTBLC59888
+
−
{{#set: smiles=C(C[N+])CC([O-])=O}}
+
−
{{#set: common name=4-aminobutanoate}}
+
−
{{#set: inchi key=InChIKey=BTCSSZJGUNDROE-UHFFFAOYSA-N}}
+
−
{{#set: molecular weight=103.121    }}
+
−
{{#set: common name=4-NH2-but|4-NH3-but|GABA|4-aminobutyric acid|γ-aminobutyrate|4-amino-n-butyric acid|γ-amino-n-butyric acid|gamma-amino-N-butyrate|g-amino-n-butyric acid}}
+
−
{{#set: consumed by=TRANS-RXN-261}}
+
−
{{#set: produced by=ABor|AMINOBUTDEHYDROG-RXN|GLUTDECARBOX-RXN|TRANS-RXN-261|GUANIDINOBUTYRASE-RXN}}
+
−
{{#set: reversible reaction associated=GABATRANSAM-RXN|RXN-14209}}
+

Latest revision as of 19:06, 21 March 2018

Pathway PWY66-3

  • taxonomic range:
  • common name:
    • cholesterol biosynthesis II (via 24,25-dihydrolanosterol)
  • Synonym(s):

Reaction(s) found

8 reactions found over 22 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY66-3&oldid=39459"