Difference between revisions of "FLAVANONES"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FLAVANONES FLAVANONES] == * common name: ** a flavanone * Synonym(s): ** 2-phenyl-4-chromanone...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FLAVANONES FLAVANONES] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a flavanone |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2-phenyl-4-chromanone |
| − | ** | + | ** 2,3-dihydro-2-phenyl-4H-1-benzopyran-4-one |
| + | ** 2,3-dihydroflavone | ||
| + | ** flavanone | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[CHALCONE-ISOMERASE-RXN]] |
| − | + | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a flavanone}} | |
| − | + | {{#set: common name=2-phenyl-4-chromanone|2,3-dihydro-2-phenyl-4H-1-benzopyran-4-one|2,3-dihydroflavone|flavanone}} | |
| − | + | {{#set: reversible reaction associated=CHALCONE-ISOMERASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: reversible reaction associated= | + | |
Latest revision as of 19:06, 21 March 2018
Contents
Metabolite FLAVANONES
- common name:
- a flavanone
- Synonym(s):
- 2-phenyl-4-chromanone
- 2,3-dihydro-2-phenyl-4H-1-benzopyran-4-one
- 2,3-dihydroflavone
- flavanone
