Difference between revisions of "SO4ASSIM-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=SO4ASSIM-PWY SO4ASSIM-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-475...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=SO4ASSIM-PWY SO4ASSIM-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | |
| − | ** | + | |
* common name: | * common name: | ||
| − | ** | + | ** sulfate reduction I (assimilatory) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''4''' reactions in the full pathway | |
| − | * [[ | + | * [[1.8.4.8-RXN]] |
| − | * [[ | + | ** 1 associated gene(s): |
| − | * [[ | + | *** [[Tiso_gene_15770]] |
| − | * [[ | + | ** 2 reconstruction source(s) associated: |
| − | == Reaction(s) | + | *** [[orthology-synechocystis]] |
| − | * [ | + | *** [[orthology-esiliculosus]] |
| − | + | * [[PWY-5340]] | |
| + | ** 0 associated gene: | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=SULFITE-REDUCT-RXN SULFITE-REDUCT-RXN] | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=SO4ASSIM-PWY SO4ASSIM-PWY] |
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=sulfate reduction I (assimilatory)}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=4}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:06, 21 March 2018
Pathway SO4ASSIM-PWY
Reaction(s) found
2 reactions found over 4 reactions in the full pathway
- 1.8.4.8-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- PWY-5340
- 0 associated gene:
Reaction(s) not found
External links
- ECOCYC:
