Difference between revisions of "PWY-401"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-METHYLXANTHINE 7-METHYLXANTHINE] == * smiles: ** CN1(C=NC2(NC(=O)NC(=O)C1=2)) * common name:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-401 PWY-401] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-401 PWY-401] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
* common name: | * common name: | ||
− | ** | + | ** galactolipid biosynthesis I |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** galactosylglyceride biosynthesis I |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''5''' reactions found over '''5''' reactions in the full pathway |
− | + | * [[2.4.1.46-RXN]] | |
− | == Reaction(s) | + | ** 2 associated gene(s): |
+ | *** [[Tiso_gene_4096]] | ||
+ | *** [[Tiso_gene_9530]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-1225]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_2142]] | ||
+ | *** [[Tiso_gene_106]] | ||
+ | *** [[Tiso_gene_11479]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-1226]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_2142]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[RXN-16635]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_2142]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[RXN-9721]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_2142]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-401 PWY-401] |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=galactolipid biosynthesis I}} | |
− | + | {{#set: common name=galactosylglyceride biosynthesis I}} | |
− | + | {{#set: reaction found=5}} | |
− | + | {{#set: total reaction=5}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:06, 21 March 2018
Pathway PWY-401
- taxonomic range:
- common name:
- galactolipid biosynthesis I
- Synonym(s):
- galactosylglyceride biosynthesis I
Reaction(s) found
5 reactions found over 5 reactions in the full pathway
- 2.4.1.46-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-1225
- 3 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-1226
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-16635
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-9721
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC: