Difference between revisions of "GLCURK"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9869 CPD-9869] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLCURK GLCURK] == * direction: ** LEFT-TO-RIGHT * common name: ** Glucuronokinase * Synonym(s): ==...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9869 CPD-9869] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLCURK GLCURK] ==
* smiles:
+
* direction:
** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N
+
 
* common name:
 
* common name:
** 2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol
+
** Glucuronokinase
* molecular weight:
+
** 821.32   
+
 
* Synonym(s):
 
* Synonym(s):
** 2-methoxy-6-decaprenyl-2-methoxy-1,4-benzoquinol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-9235]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[ATP]][c] '''+''' 1.0 [[D-Glucopyranuronate]][c] '''=>''' 1.0 [[ADP]][c] '''+''' 1.0 [[CPD-510]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 ATP[c] '''+''' 1.0 D-glucopyranuronate[c] '''=>''' 1.0 ADP[c] '''+''' 1.0 α-D-glucuronate 1-phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_12191]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986248 50986248]
+
{{#set: common name=Glucuronokinase}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_12191}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64180 64180]
+
{{#set: in pathway=}}
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C}}
+
{{#set: reconstruction category=orthology}}
{{#set: inchi key=InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: common name=2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: molecular weight=821.32    }}
+
{{#set: common name=2-methoxy-6-decaprenyl-2-methoxy-1,4-benzoquinol}}
+
{{#set: consumed by=RXN-9235}}
+

Latest revision as of 20:06, 21 March 2018

Reaction GLCURK

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Glucuronokinase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 ATP[c] + 1.0 D-glucopyranuronate[c] => 1.0 ADP[c] + 1.0 α-D-glucuronate 1-phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links