Difference between revisions of "CPD-9869"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1130 RXN1G-1130] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-delta2-cis-delta19-...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9869 CPD-9869] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CC...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1130 RXN1G-1130] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9869 CPD-9869] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C
 
* common name:
 
* common name:
−
** trans-delta2-cis-delta19-C38:2-[acyl-carrier protein] reductase
+
** 2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.3.1.M4 EC-1.3.1.M4]
+
** InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N
 +
* molecular weight:
 +
** 821.32   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-methoxy-6-decaprenyl-2-methoxy-1,4-benzoquinol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-9235]]
−
** 1 [[trans-D2-cis-D19-C38-ACPs]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[cis-delta19-C38-ACPs]][c] '''+''' 1 [[NAD]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a trans-delta2-cis-delta19-C38:2-[acp][c] '''+''' 1 NADH[c] '''+''' 1 H+[c] '''=>''' 1 a cis-delta19-C38:1-[acp][c] '''+''' 1 NAD+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_10778]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
+
−
** '''86''' reactions found over '''182''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=trans-delta2-cis-delta19-C38:2-[acyl-carrier protein] reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986248 50986248]
−
{{#set: ec number=EC-1.3.1.M4}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_10778}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64180 64180]
−
{{#set: in pathway=PWYG-321}}
+
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N}}
−
{{#set: reconstruction source=esiliculosus}}
+
{{#set: molecular weight=821.32    }}
 +
{{#set: common name=2-methoxy-6-decaprenyl-2-methoxy-1,4-benzoquinol}}
 +
{{#set: consumed by=RXN-9235}}

Latest revision as of 19:06, 21 March 2018

Metabolite CPD-9869

  • smiles:
    • CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C
  • common name:
    • 2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol
  • inchi key:
    • InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N
  • molecular weight:
    • 821.32
  • Synonym(s):
    • 2-methoxy-6-decaprenyl-2-methoxy-1,4-benzoquinol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-9869&oldid=39516"