Difference between revisions of "CPD-590"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AKBLIG-RXN AKBLIG-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** glycine_c-acetyltransfera...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-590 CPD-590] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O) * common...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-590 CPD-590] == |
− | * | + | * smiles: |
− | ** | + | ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O) |
* common name: | * common name: | ||
− | ** | + | ** (2R,3S,4S)-leucocyanidin |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=SBZWTSHAFILOTE-SOUVJXGZSA-N |
+ | * molecular weight: | ||
+ | ** 306.271 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2,3-trans-3,4-cis-leucocyanidin | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-602]] |
− | + | * [[1.14.11.19-RXN]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-600]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440833 440833] |
− | * | + | * CHEMSPIDER: |
− | ** [http://www. | + | ** [http://www.chemspider.com/Chemical-Structure.389677.html 389677] |
− | + | * CHEBI: | |
− | * | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=11412 11412] |
− | ** [http://www. | + | * METABOLIGHTS : MTBLC11412 |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05906 C05906] | |
− | * | + | {{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O)}} |
− | * | + | {{#set: common name=(2R,3S,4S)-leucocyanidin}} |
− | ** [http://www. | + | {{#set: inchi key=InChIKey=SBZWTSHAFILOTE-SOUVJXGZSA-N}} |
− | {{#set: | + | {{#set: molecular weight=306.271 }} |
− | {{#set: common name= | + | {{#set: common name=2,3-trans-3,4-cis-leucocyanidin}} |
− | {{#set: | + | {{#set: consumed by=RXN-602|1.14.11.19-RXN}} |
− | {{#set: | + | {{#set: produced by=RXN-600}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:06, 21 March 2018
Contents
Metabolite CPD-590
- smiles:
- C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O)
- common name:
- (2R,3S,4S)-leucocyanidin
- inchi key:
- InChIKey=SBZWTSHAFILOTE-SOUVJXGZSA-N
- molecular weight:
- 306.271
- Synonym(s):
- 2,3-trans-3,4-cis-leucocyanidin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links