Difference between revisions of "PWY-5901"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] == * smiles: ** C(CC[N+]CCCCC[N+])[N+] * inchi key: ** InChIKey=QZBYOYPROV...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5901 PWY-5901] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5901 PWY-5901] ==
* smiles:
+
* taxonomic range:
** C(CC[N+]CCCCC[N+])[N+]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q
+
 
* common name:
 
* common name:
** aminopropylcadaverine
+
** 2,3-dihydroxybenzoate biosynthesis
* molecular weight:
+
** 162.298   
+
 
* Synonym(s):
 
* Synonym(s):
** N-3-aminopropyl-1,5-diaminopentane
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''3''' reactions in the full pathway
* [[RXN0-5217]]
+
* [[DHBDEHYD-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_8022]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[ISOCHORSYN-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_14767]]
 +
*** [[Tiso_gene_17551]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ISOCHORMAT-RXN ISOCHORMAT-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246266 25246266]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5901 PWY-5901]
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64858 64858]
+
{{#set: common name=2,3-dihydroxybenzoate biosynthesis}}
* LIGAND-CPD:
+
{{#set: reaction found=2}}
** [http://www.genome.jp/dbget-bin/www_bget?C16565 C16565]
+
{{#set: total reaction=3}}
* HMDB : HMDB12189
+
{{#set: completion rate=67.0}}
{{#set: smiles=C(CC[N+]CCCCC[N+])[N+]}}
+
{{#set: inchi key=InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q}}
+
{{#set: common name=aminopropylcadaverine}}
+
{{#set: molecular weight=162.298    }}
+
{{#set: common name=N-3-aminopropyl-1,5-diaminopentane}}
+
{{#set: produced by=RXN0-5217}}
+

Latest revision as of 19:06, 21 March 2018

Pathway PWY-5901

  • taxonomic range:
  • common name:
    • 2,3-dihydroxybenzoate biosynthesis
  • Synonym(s):

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links