Difference between revisions of "PHOSLIPSYN2-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18085 CPD-18085] == * smiles: ** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PHOSLIPSYN2-PWY PHOSLIPSYN2-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=T...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18085 CPD-18085] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PHOSLIPSYN2-PWY PHOSLIPSYN2-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
−
** InChIKey=SNZSFAQYVLPEBZ-NNYOXOHSSA-J
+
 
* common name:
 
* common name:
−
** 1,2-dihydro-β-NADP
+
** superpathway of phospholipid biosynthesis II (plants)
−
* molecular weight:
+
−
** 741.394   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-dihydro-nicotinamide adenine dinucleotide phosphate
+
** phosphoglyceride biosynthesis
−
** 2DHNADP
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''8''' reactions found over '''23''' reactions in the full pathway
−
* [[RXN-16765]]
+
* [[2.7.8.11-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_6541]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[PWY-5667]]
 +
** 0 associated gene:
 +
* [[PWY-5669]]
 +
** 0 associated gene:
 +
* [[PWY0-1319]]
 +
** 0 associated gene:
 +
* [[PWY3O-450]]
 +
** 0 associated gene:
 +
* [[PWY4FS-6]]
 +
** 0 associated gene:
 +
* [[PWY4FS-7]]
 +
** 0 associated gene:
 +
* [[PWY4FS-8]]
 +
** 0 associated gene:
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHASERSYN-RXN PHOSPHASERSYN-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-2 PWY4FS-2]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-2 PWY4FS-2]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-3 PWY4FS-3]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-3 PWY4FS-3]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-4 PWY4FS-4]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-4 PWY4FS-4]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1382 RXN-1382]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ARACYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92136136 92136136]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PHOSLIPSYN2-PWY PHOSLIPSYN2-PWY]
−
* CHEBI:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=88137 88137]
+
{{#set: common name=superpathway of phospholipid biosynthesis II (plants)}}
−
{{#set: smiles=C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N)}}
+
{{#set: common name=phosphoglyceride biosynthesis}}
−
{{#set: inchi key=InChIKey=SNZSFAQYVLPEBZ-NNYOXOHSSA-J}}
+
{{#set: reaction found=8}}
−
{{#set: common name=1,2-dihydro-β-NADP}}
+
{{#set: total reaction=23}}
−
{{#set: molecular weight=741.394    }}
+
{{#set: completion rate=35.0}}
−
{{#set: common name=2-dihydro-nicotinamide adenine dinucleotide phosphate|2DHNADP}}
+
−
{{#set: produced by=RXN-16765}}
+

Latest revision as of 19:07, 21 March 2018

Pathway PHOSLIPSYN2-PWY

  • taxonomic range:
  • common name:
    • superpathway of phospholipid biosynthesis II (plants)
  • Synonym(s):
    • phosphoglyceride biosynthesis

Reaction(s) found

8 reactions found over 23 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PHOSLIPSYN2-PWY&oldid=39608"