Difference between revisions of "1.3.7.4-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CMP CMP] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))OP([O-])([O-])=O * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.7.4-RXN 1.3.7.4-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.7.4-RXN 1.3.7.4-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.3.7.4 EC-1.3.7.4] |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * | + | * With identifiers: |
− | * [[ | + | ** 1 [[BILIVERDINE]][c] '''+''' 2 [[PROTON]][c] '''+''' 2 [[Reduced-ferredoxins]][c] '''=>''' 1 [[3Z-PHYTOCHROMOBILIN]][c] '''+''' 2 [[Oxidized-ferredoxins]][c] |
− | + | * With common name(s): | |
− | + | ** 1 biliverdin-IX-α[c] '''+''' 2 H+[c] '''+''' 2 a reduced ferredoxin [iron-sulfur] cluster[c] '''=>''' 1 (3Z)-phytochromobilin[c] '''+''' 2 an oxidized ferredoxin [iron-sulfur] cluster[c] | |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
− | + | * Gene: [[Tiso_gene_17350]] | |
− | + | ** Source: [[orthology-athaliana]] | |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | + | == Pathways == | |
− | + | * [[PWY-7170]], phytochromobilin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7170 PWY-7170] | |
− | * | + | ** '''1''' reactions found over '''3''' reactions in the full pathway |
− | * [ | + | == Reconstruction information == |
− | + | * Category: [[orthology]] | |
− | + | ** Source: [[orthology-athaliana]] | |
− | + | *** Tool: [[pantograph]] | |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | *** Tool: [[pantograph]] |
− | * | + | |
− | * [[ | + | |
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03678 R03678] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-1.3.7.4}} | |
− | + | {{#set: gene associated=Tiso_gene_17350}} | |
− | * LIGAND- | + | {{#set: in pathway=PWY-7170}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction category=orthology}} |
− | + | {{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:07, 21 March 2018
Contents
Reaction 1.3.7.4-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 BILIVERDINE[c] + 2 PROTON[c] + 2 Reduced-ferredoxins[c] => 1 3Z-PHYTOCHROMOBILIN[c] + 2 Oxidized-ferredoxins[c]
- With common name(s):
- 1 biliverdin-IX-α[c] + 2 H+[c] + 2 a reduced ferredoxin [iron-sulfur] cluster[c] => 1 (3Z)-phytochromobilin[c] + 2 an oxidized ferredoxin [iron-sulfur] cluster[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_17350
- Source: orthology-athaliana
- Source: orthology-esiliculosus
Pathways
- PWY-7170, phytochromobilin biosynthesis: PWY-7170
- 1 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
External links
- LIGAND-RXN: