Difference between revisions of "GLYSYN-ALA-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYSYN-ALA-PWY GLYSYN-ALA-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYSYN-ALA-PWY GLYSYN-ALA-PWY] ==
* smiles:
+
* taxonomic range:
** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
** InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 
* common name:
 
* common name:
** delphinidin 3,5-di-O-β-D-glucoside
+
** glycine biosynthesis III
* molecular weight:
+
** 626.524   
+
 
* Synonym(s):
 
* Synonym(s):
** delphinidin-3,5-diglucoside
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''1''' reactions in the full pathway
* [[RXN-8228]]
+
* [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Tiso_gene_6134]]
 +
*** [[Tiso_gene_5726]]
 +
*** [[Tiso_gene_11231]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201902 25201902]
+
{{#set: taxonomic range=TAX-2157}}
* CHEBI:
+
{{#set: taxonomic range=TAX-2759}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77838 77838]
+
{{#set: common name=glycine biosynthesis III}}
* LIGAND-CPD:
+
{{#set: reaction found=1}}
** [http://www.genome.jp/dbget-bin/www_bget?C16312 C16312]
+
{{#set: total reaction=1}}
* HMDB : HMDB30693
+
{{#set: completion rate=100.0}}
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))}}
+
{{#set: inchi key=InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N}}
+
{{#set: common name=delphinidin 3,5-di-O-β-D-glucoside}}
+
{{#set: molecular weight=626.524    }}
+
{{#set: common name=delphinidin-3,5-diglucoside}}
+
{{#set: produced by=RXN-8228}}
+

Latest revision as of 20:07, 21 March 2018

Pathway GLYSYN-ALA-PWY

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links