Difference between revisions of "APIGNAR-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] == * smiles: ** C(C([N+])C(=O)[O-])S(=O)(=O)[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=APIGNAR-RXN APIGNAR-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Naringenin chalcone iso...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=APIGNAR-RXN APIGNAR-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Naringenin chalcone isomerase |
− | * | + | ** atp-dependent_rna_helicase_dhx30-like |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/5.5.1.6 EC-5.5.1.6] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[APIGENIN]][c] '''=>''' 1 [[NARINGENIN-CMPD]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 2',4,4',6'-tetrahydroxychalcone[c] '''=>''' 1 (2S)-naringenin[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_13414]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_9838]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-7397]], naringenin biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7397 PWY-7397] | ||
+ | ** '''2''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY1F-FLAVSYN]], flavonoid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY1F-FLAVSYN PWY1F-FLAVSYN] | ||
+ | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-6787]], flavonoid biosynthesis (in equisetum): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6787 PWY-6787] | ||
+ | ** '''5''' reactions found over '''10''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02446 R02446] |
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P11650 P11650] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P11651 P11651] |
− | * | + | ** [http://www.uniprot.org/uniprot/P41088 P41088] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P14298 P14298] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q42925 Q42925] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q42926 Q42926] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q08704 Q08704] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P28012 P28012] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P41089 P41089] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/O81980 O81980] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O22604 O22604] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O22651 O22651] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q43754 Q43754] |
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=Naringenin chalcone isomerase}} | ||
+ | {{#set: common name=atp-dependent_rna_helicase_dhx30-like}} | ||
+ | {{#set: ec number=EC-5.5.1.6}} | ||
+ | {{#set: gene associated=Tiso_gene_13414|Tiso_gene_9838}} | ||
+ | {{#set: in pathway=PWY-7397|PWY1F-FLAVSYN|PWY-6787}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 20:07, 21 March 2018
Contents
Reaction APIGNAR-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Naringenin chalcone isomerase
- atp-dependent_rna_helicase_dhx30-like
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 APIGENIN[c] => 1 NARINGENIN-CMPD[c]
- With common name(s):
- 1 2',4,4',6'-tetrahydroxychalcone[c] => 1 (2S)-naringenin[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_13414
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_9838
- Source: orthology-esiliculosus
Pathways
- PWY-7397, naringenin biosynthesis (engineered): PWY-7397
- 2 reactions found over 4 reactions in the full pathway
- PWY1F-FLAVSYN, flavonoid biosynthesis: PWY1F-FLAVSYN
- 4 reactions found over 5 reactions in the full pathway
- PWY-6787, flavonoid biosynthesis (in equisetum): PWY-6787
- 5 reactions found over 10 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- LIGAND-RXN:
- UNIPROT: