Difference between revisions of "CPD-7139"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16540 RXN-16540] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-coenzyme_a_oxidase **...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16540 RXN-16540] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))
 
* common name:
 
* common name:
** acyl-coenzyme_a_oxidase
+
** delphinidin 3,5-di-O-β-D-glucoside
** ORF
+
* inchi key:
** acyl-_dehydrogenase
+
** InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N
** acyl-CoA_dehydrogenase
+
* molecular weight:
* ec number:
+
** 626.524   
** [http://enzyme.expasy.org/EC/1.3.8.9 EC-1.3.8.9]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** delphinidin-3,5-diglucoside
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[PROTON]][c] '''+''' 1 [[ETF-Oxidized]][c] '''+''' 1 [[PALMITYL-COA]][c] '''=>''' 1 [[CPD0-2117]][c] '''+''' 1 [[ETF-Reduced]][c]
+
* [[RXN-8228]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 H+[c] '''+''' 1 an oxidized electron-transfer flavoprotein[c] '''+''' 1 palmitoyl-CoA[c] '''=>''' 1 trans-hexadec-2-enoyl-CoA[c] '''+''' 1 a reduced electron-transfer flavoprotein[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* Gene: [[Tiso_gene_6475]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: EC-NUMBER
+
* Gene: [[Tiso_gene_5991]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: EC-NUMBER
+
* Gene: [[Tiso_gene_16631]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: EC-NUMBER
+
* Gene: [[Tiso_gene_18566]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: EC-NUMBER
+
* Gene: [[Tiso_gene_883]]
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: EC-NUMBER
+
* Gene: [[Tiso_gene_17967]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: EC-NUMBER
+
== Pathways  ==
+
* [[PWY-7654]], (8E,10E)-dodeca-8,10-dienol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7654 PWY-7654]
+
** '''6''' reactions found over '''11''' reactions in the full pathway
+
* [[PWY-7656]], Spodoptera littoralis pheromone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7656 PWY-7656]
+
** '''6''' reactions found over '''22''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Tool: [[pathwaytools]]
+
** Source: [[annotation-experimental_annotation]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=acyl-coenzyme_a_oxidase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201902 25201902]
{{#set: common name=ORF}}
+
* HMDB : HMDB30693
{{#set: common name=acyl-_dehydrogenase}}
+
* CHEBI:
{{#set: common name=acyl-CoA_dehydrogenase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77838 77838]
{{#set: ec number=EC-1.3.8.9}}
+
* LIGAND-CPD:
{{#set: gene associated=Tiso_gene_6475|Tiso_gene_5991|Tiso_gene_16631|Tiso_gene_18566|Tiso_gene_883|Tiso_gene_17967}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16312 C16312]
{{#set: in pathway=PWY-7654|PWY-7656}}
+
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))}}
{{#set: reconstruction category=annotation}}
+
{{#set: common name=delphinidin 3,5-di-O-β-D-glucoside}}
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
+
{{#set: inchi key=InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=626.524    }}
 +
{{#set: common name=delphinidin-3,5-diglucoside}}
 +
{{#set: produced by=RXN-8228}}

Latest revision as of 19:07, 21 March 2018

Metabolite CPD-7139

  • smiles:
    • C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))
  • common name:
    • delphinidin 3,5-di-O-β-D-glucoside
  • inchi key:
    • InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N
  • molecular weight:
    • 626.524
  • Synonym(s):
    • delphinidin-3,5-diglucoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))" cannot be used as a page name in this wiki.