Difference between revisions of "CPD-7139"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_13799 == * left end position: ** 7217 * transcription direction: ** POSITIVE * right end position: ** 9278 * centisome position: ** 76.3865...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5))) |
| − | * | + | * common name: |
| − | ** | + | ** delphinidin 3,5-di-O-β-D-glucoside |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 626.524 |
* Synonym(s): | * Synonym(s): | ||
| + | ** delphinidin-3,5-diglucoside | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-8228]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201902 25201902] |
| − | {{#set: | + | * HMDB : HMDB30693 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77838 77838] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C16312 C16312] | ||
| + | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))}} | ||
| + | {{#set: common name=delphinidin 3,5-di-O-β-D-glucoside}} | ||
| + | {{#set: inchi key=InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N}} | ||
| + | {{#set: molecular weight=626.524 }} | ||
| + | {{#set: common name=delphinidin-3,5-diglucoside}} | ||
| + | {{#set: produced by=RXN-8228}} | ||
Latest revision as of 20:07, 21 March 2018
Contents
Metabolite CPD-7139
- smiles:
- C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))
- common name:
- delphinidin 3,5-di-O-β-D-glucoside
- inchi key:
- InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N
- molecular weight:
- 626.524
- Synonym(s):
- delphinidin-3,5-diglucoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))" cannot be used as a page name in this wiki.
