Difference between revisions of "CPD-4581"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=PYMYPHUHKU...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] == |
* smiles: | * smiles: | ||
| − | ** [CH](=O) | + | ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34)))) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 5α-cholesta-8,24-dien-3-one |
| + | * inchi key: | ||
| + | ** InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 382.628 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN66-318]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298942 22298942] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52386 52386] |
| − | + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))}} | |
| − | + | {{#set: common name=5α-cholesta-8,24-dien-3-one}} | |
| − | {{#set: smiles=[CH](=O) | + | {{#set: inchi key=InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N}} |
| − | {{#set: | + | {{#set: molecular weight=382.628 }} |
| − | {{#set: | + | {{#set: produced by=RXN66-318}} |
| − | {{#set: molecular weight= | + | |
| − | {{#set: | + | |
Latest revision as of 19:07, 21 March 2018
Contents
Metabolite CPD-4581
- smiles:
- CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))
- common name:
- 5α-cholesta-8,24-dien-3-one
- inchi key:
- InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N
- molecular weight:
- 382.628
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.
