Difference between revisions of "M5TAP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == * smiles: ** C(CC([N+])C(=O)[O-])ONC(=[N+])N * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=M5TAP M5TAP] == * direction: ** LEFT-TO-RIGHT * common name: ** S-methyl-5'-thioadenosine phosphory...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=M5TAP M5TAP] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** S-methyl-5'-thioadenosine phosphorylase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1.0 [[Pi]][c] '''+''' 1.0 [[5-METHYLTHIOADENOSINE]][c] '''=>''' 1.0 [[CPD-444]][c] '''+''' 1.0 [[ADENINE]][c] |
| − | == | + | * With common name(s): |
| + | ** 1.0 phosphate[c] '''+''' 1.0 S-methyl-5'-thioadenosine[c] '''=>''' 1.0 S-methyl-5-thio-α-D-ribose 1-phosphate[c] '''+''' 1.0 adenine[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_20384]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=S-methyl-5'-thioadenosine phosphorylase}} | |
| − | + | {{#set: gene associated=Tiso_gene_20384}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:07, 21 March 2018
Contents
Reaction M5TAP
- direction:
- LEFT-TO-RIGHT
- common name:
- S-methyl-5'-thioadenosine phosphorylase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 Pi[c] + 1.0 5-METHYLTHIOADENOSINE[c] => 1.0 CPD-444[c] + 1.0 ADENINE[c]
- With common name(s):
- 1.0 phosphate[c] + 1.0 S-methyl-5'-thioadenosine[c] => 1.0 S-methyl-5-thio-α-D-ribose 1-phosphate[c] + 1.0 adenine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_20384
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
