Difference between revisions of "Tiso gene 12618"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11690 CPD-11690] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O * inchi key: ** InChIKey=R...") |
(Created page with "Category:Gene == Gene Tiso_gene_12618 == * right end position: ** 6797 * transcription direction: ** NEGATIVE * left end position: ** 2352 * centisome position: ** 34.4564...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12618 == |
− | * | + | * right end position: |
− | ** | + | ** 6797 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 2352 |
− | * | + | * centisome position: |
− | ** | + | ** 34.45649 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[3.6.3.50-RXN]] |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | == | + | * Reaction: [[ADENOSINETRIPHOSPHATASE-RXN]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[ATPASE-RXN]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Reaction: [[ATPSYN-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7219]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=6797}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=2352}} | |
− | + | {{#set: centisome position=34.45649 }} | |
− | + | {{#set: reaction associated=3.6.3.50-RXN|ADENOSINETRIPHOSPHATASE-RXN|ATPASE-RXN|ATPSYN-RXN}} | |
− | + | {{#set: pathway associated=PWY-7219}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:07, 21 March 2018
Gene Tiso_gene_12618
- right end position:
- 6797
- transcription direction:
- NEGATIVE
- left end position:
- 2352
- centisome position:
- 34.45649
- Synonym(s):
Reactions associated
- Reaction: 3.6.3.50-RXN
- Source: orthology-esiliculosus
- Reaction: ADENOSINETRIPHOSPHATASE-RXN
- Source: orthology-esiliculosus
- Reaction: ATPASE-RXN
- Source: orthology-athaliana
- Reaction: ATPSYN-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation