Difference between revisions of "RXN-15043"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-115 CPD1F-115] == * smiles: ** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15043 RXN-15043] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-acylglycerol-3-phosphate_...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-115 CPD1F-115] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15043 RXN-15043] ==
−
* smiles:
+
* direction:
−
** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))C)C)C)C)C)C
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** δ-carotene
+
** 1-acylglycerol-3-phosphate_o-acyltransferase
−
* inchi key:
+
* ec number:
−
** InChIKey=WGIYGODPCLMGQH-GOXCNPTKSA-N
+
** [http://enzyme.expasy.org/EC/2.3.1.51 EC-2.3.1.51]
−
* molecular weight:
+
−
** 536.882   
+
 
* Synonym(s):
 
* Synonym(s):
−
** ε,ψ-carotene
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-8028]]
+
* With identifiers:
−
* [[RXN1F-148]]
+
** 1 [[OLEOYL-COA]][c] '''+''' 1 [[L-1-LYSOPHOSPHATIDATE]][c] '''=>''' 1 [[CPD-8268]][c] '''+''' 1 [[CO-A]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RXN1F-147]]
+
** 1 oleoyl-CoA[c] '''+''' 1 1-oleyl-2-lyso-phosphatidate[c] '''=>''' 1 dioleoyl phosphatidate[c] '''+''' 1 coenzyme A[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13959]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7411]], phosphatidate biosynthesis (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7411 PWY-7411]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY-7417]], phospholipid remodeling (phosphatidate, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7417 PWY-7417]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5281230 5281230]
+
{{#set: common name=1-acylglycerol-3-phosphate_o-acyltransferase}}
−
* CHEMSPIDER:
+
{{#set: ec number=EC-2.3.1.51}}
−
** [http://www.chemspider.com/Chemical-Structure.4444642.html 4444642]
+
{{#set: gene associated=Tiso_gene_13959}}
−
* HMDB : HMDB36925
+
{{#set: in pathway=PWY-7411|PWY-7417}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology|annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27705 27705]
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
−
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08586 C08586]
+
−
{{#set: smiles=CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))C)C)C)C)C)C}}
+
−
{{#set: common name=δ-carotene}}
+
−
{{#set: inchi key=InChIKey=WGIYGODPCLMGQH-GOXCNPTKSA-N}}
+
−
{{#set: molecular weight=536.882    }}
+
−
{{#set: common name=ε,ψ-carotene}}
+
−
{{#set: consumed by=RXN-8028|RXN1F-148}}
+
−
{{#set: produced by=RXN1F-147}}
+

Latest revision as of 19:08, 21 March 2018

Reaction RXN-15043

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 1-acylglycerol-3-phosphate_o-acyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7411, phosphatidate biosynthesis (yeast): PWY-7411
    • 5 reactions found over 5 reactions in the full pathway
  • PWY-7417, phospholipid remodeling (phosphatidate, yeast): PWY-7417
    • 2 reactions found over 2 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-15043&oldid=39672"