Difference between revisions of "DNA-Ligase-L-lysine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * common name: ** aldehydo-L-arabin...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-Ligase-L-lysine DNA-Ligase-L-lysine] == * common name: ** a [DNA ligase]-L-lysine * Synonym...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-Ligase-L-lysine DNA-Ligase-L-lysine] ==
* smiles:
+
** [CH](=O)C(O)C(O)C(O)CO
+
 
* common name:
 
* common name:
** aldehydo-L-arabinose
+
** a [DNA ligase]-L-lysine
* inchi key:
+
** InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N
+
* molecular weight:
+
** 150.131   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17917]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17918]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-14102]]
 
* [[RXN-14808]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a [DNA ligase]-L-lysine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460291 5460291]
+
{{#set: consumed by=RXN-17917}}
* CHEBI:
+
{{#set: produced by=RXN-17918}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6182 6182]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11476 C11476]
+
{{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}}
+
{{#set: common name=aldehydo-L-arabinose}}
+
{{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N}}
+
{{#set: molecular weight=150.131    }}
+
{{#set: reversible reaction associated=RXN-14102|RXN-14808}}
+

Latest revision as of 20:08, 21 March 2018

Metabolite DNA-Ligase-L-lysine

  • common name:
    • a [DNA ligase]-L-lysine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [DNA ligase]-L-lysine" cannot be used as a page name in this wiki.