Difference between revisions of "DNA-Ligase-L-lysine"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDROXYBENZOATE 2-3-DIHYDROXYBENZOATE] == * smiles: ** C(C1(=CC=CC(=C1O)O))([O-])=O * inc...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-Ligase-L-lysine DNA-Ligase-L-lysine] == * common name: ** a [DNA ligase]-L-lysine * Synonym...") |
||
| (4 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-Ligase-L-lysine DNA-Ligase-L-lysine] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a [DNA ligase]-L-lysine |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-17917]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17918]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a [DNA ligase]-L-lysine}} | |
| − | + | {{#set: consumed by=RXN-17917}} | |
| − | + | {{#set: produced by=RXN-17918}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | {{#set: produced by= | + | |
Latest revision as of 20:08, 21 March 2018
Contents
Metabolite DNA-Ligase-L-lysine
- common name:
- a [DNA ligase]-L-lysine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [DNA ligase]-L-lysine" cannot be used as a page name in this wiki.
