Difference between revisions of "PWY-6075"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIPOYL-AMP LIPOYL-AMP] == * smiles: ** C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6075 PWY-6075] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIPOYL-AMP LIPOYL-AMP] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6075 PWY-6075] ==
* smiles:
+
* taxonomic range:
** C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))([O-])=O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** InChIKey=QWEGOCJRZOKSOE-ADUAKINBSA-M
+
 
* common name:
 
* common name:
** lipoyl-adenylate
+
** ergosterol biosynthesis I
* molecular weight:
+
** 534.518   
+
 
* Synonym(s):
 
* Synonym(s):
** lipoyl-AMP
+
** ergosterol biosynthesis I (fungi)
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-13039]]
+
'''1''' reactions found over '''5''' reactions in the full pathway
* [[RXN-8655]]
+
* [[RXN3O-218]]
== Reaction(s) known to produce the compound ==
+
** 1 associated gene(s):
* [[RXN-8654]]
+
*** [[Tiso_gene_5446]]
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=1.3.1.71-RXN 1.3.1.71-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-178 RXN3O-178]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-203 RXN3O-203]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-227 RXN3O-227]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245420 25245420]
+
{{#set: common name=ergosterol biosynthesis I}}
* CHEBI:
+
{{#set: common name=ergosterol biosynthesis I (fungi)}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83091 83091]
+
{{#set: reaction found=1}}
* LIGAND-CPD:
+
{{#set: total reaction=5}}
** [http://www.genome.jp/dbget-bin/www_bget?C16238 C16238]
+
{{#set: completion rate=20.0}}
* HMDB : HMDB59635
+
{{#set: smiles=C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))([O-])=O)}}
+
{{#set: inchi key=InChIKey=QWEGOCJRZOKSOE-ADUAKINBSA-M}}
+
{{#set: common name=lipoyl-adenylate}}
+
{{#set: molecular weight=534.518    }}
+
{{#set: common name=lipoyl-AMP}}
+
{{#set: consumed by=RXN-13039|RXN-8655}}
+
{{#set: produced by=RXN-8654}}
+

Latest revision as of 20:08, 21 March 2018

Pathway PWY-6075

  • taxonomic range:
  • common name:
    • ergosterol biosynthesis I
  • Synonym(s):
    • ergosterol biosynthesis I (fungi)

Reaction(s) found

1 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links