Difference between revisions of "CYANURIC-ACID"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DUTCP DUTCP] == * direction: ** LEFT-TO-RIGHT * common name: ** dUTP:cytidine 5'-phosphotransferase...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYANURIC-ACID CYANURIC-ACID] == * smiles: ** C1(O)(=NC(O)=NC(O)=N1) * common name: ** cyanurate...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DUTCP DUTCP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYANURIC-ACID CYANURIC-ACID] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(O)(=NC(O)=NC(O)=N1)
 
* common name:
 
* common name:
−
** dUTP:cytidine 5'-phosphotransferase
+
** cyanurate
 +
* inchi key:
 +
** InChIKey=ZFSLODLOARCGLH-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 129.075   
 
* Synonym(s):
 
* Synonym(s):
 +
** cyanuric acid
 +
** 2,4,6-trihydroxy-s-triazine
 +
** sym-triazine-2,4,6-triol
 +
** 1,3,5-triazine-2,4,6-triol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[R468-RXN]]
−
** 1.0 [[CYTIDINE]][c] '''+''' 1.0 [[DUTP]][c] '''=>''' 1.0 [[CMP]][c] '''+''' 1.0 [[DUDP]][c] '''+''' 1.0 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 cytidine[c] '''+''' 1.0 dUTP[c] '''=>''' 1.0 CMP[c] '''+''' 1.0 dUDP[c] '''+''' 1.0 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_20134]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_14474]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=dUTP:cytidine 5'-phosphotransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7956 7956]
−
{{#set: gene associated=Tiso_gene_20134|Tiso_gene_14474}}
+
* CAS : 108-80-5
−
{{#set: in pathway=}}
+
* NCI:
−
{{#set: reconstruction category=orthology}}
+
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=6284 6284]
−
{{#set: reconstruction source=orthology-creinhardtii}}
+
* HMDB : HMDB41861
−
{{#set: reconstruction tool=pantograph}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C06554 C06554]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.7668.html 7668]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38028 38028]
 +
{{#set: smiles=C1(O)(=NC(O)=NC(O)=N1)}}
 +
{{#set: common name=cyanurate}}
 +
{{#set: inchi key=InChIKey=ZFSLODLOARCGLH-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=129.075    }}
 +
{{#set: common name=cyanuric acid|2,4,6-trihydroxy-s-triazine|sym-triazine-2,4,6-triol|1,3,5-triazine-2,4,6-triol}}
 +
{{#set: consumed by=R468-RXN}}

Latest revision as of 19:08, 21 March 2018

Metabolite CYANURIC-ACID

  • smiles:
    • C1(O)(=NC(O)=NC(O)=N1)
  • common name:
    • cyanurate
  • inchi key:
    • InChIKey=ZFSLODLOARCGLH-UHFFFAOYSA-N
  • molecular weight:
    • 129.075
  • Synonym(s):
    • cyanuric acid
    • 2,4,6-trihydroxy-s-triazine
    • sym-triazine-2,4,6-triol
    • 1,3,5-triazine-2,4,6-triol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CYANURIC-ACID&oldid=39686"