Difference between revisions of "CYANURIC-ACID"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14404 CPD-14404] == * smiles: ** CCCCCC=CCC=CCC=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYANURIC-ACID CYANURIC-ACID] == * smiles: ** C1(O)(=NC(O)=NC(O)=N1) * common name: ** cyanurate...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYANURIC-ACID CYANURIC-ACID] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(O)(=NC(O)=NC(O)=N1) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** cyanurate |
+ | * inchi key: | ||
+ | ** InChIKey=ZFSLODLOARCGLH-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 129.075 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** cyanuric acid |
− | ** | + | ** 2,4,6-trihydroxy-s-triazine |
+ | ** sym-triazine-2,4,6-triol | ||
+ | ** 1,3,5-triazine-2,4,6-triol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[R468-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7956 7956] |
+ | * CAS : 108-80-5 | ||
+ | * NCI: | ||
+ | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=6284 6284] | ||
+ | * HMDB : HMDB41861 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C06554 C06554] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.7668.html 7668] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38028 38028] |
− | {{#set: smiles= | + | {{#set: smiles=C1(O)(=NC(O)=NC(O)=N1)}} |
− | {{#set: | + | {{#set: common name=cyanurate}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=ZFSLODLOARCGLH-UHFFFAOYSA-N}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=129.075 }} |
− | {{#set: common name= | + | {{#set: common name=cyanuric acid|2,4,6-trihydroxy-s-triazine|sym-triazine-2,4,6-triol|1,3,5-triazine-2,4,6-triol}} |
− | {{#set: consumed by= | + | {{#set: consumed by=R468-RXN}} |
Latest revision as of 19:08, 21 March 2018
Contents
Metabolite CYANURIC-ACID
- smiles:
- C1(O)(=NC(O)=NC(O)=N1)
- common name:
- cyanurate
- inchi key:
- InChIKey=ZFSLODLOARCGLH-UHFFFAOYSA-N
- molecular weight:
- 129.075
- Synonym(s):
- cyanuric acid
- 2,4,6-trihydroxy-s-triazine
- sym-triazine-2,4,6-triol
- 1,3,5-triazine-2,4,6-triol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- CAS : 108-80-5
- NCI:
- HMDB : HMDB41861
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI: