Difference between revisions of "PRPPSYN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYANURIC-ACID CYANURIC-ACID] == * smiles: ** C1(O)(=NC(O)=NC(O)=N1) * common name: ** cyanurate...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PRPPSYN-RXN PRPPSYN-RXN] == * direction: ** REVERSIBLE * common name: ** ORF * ec number: ** [http:...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYANURIC-ACID CYANURIC-ACID] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PRPPSYN-RXN PRPPSYN-RXN] ==
* smiles:
+
* direction:
** C1(O)(=NC(O)=NC(O)=N1)
+
** REVERSIBLE
 
* common name:
 
* common name:
** cyanurate
+
** ORF
* inchi key:
+
* ec number:
** InChIKey=ZFSLODLOARCGLH-UHFFFAOYSA-N
+
** [http://enzyme.expasy.org/EC/2.7.6.1 EC-2.7.6.1]
* molecular weight:
+
** 129.075   
+
 
* Synonym(s):
 
* Synonym(s):
** cyanuric acid
 
** 2,4,6-trihydroxy-s-triazine
 
** sym-triazine-2,4,6-triol
 
** 1,3,5-triazine-2,4,6-triol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[R468-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[ATP]][c] '''+''' 1 [[RIBOSE-5P]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[PRPP]][c] '''+''' 1 [[AMP]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 ATP[c] '''+''' 1 D-ribose 5-phosphate[c] '''<=>''' 1 H+[c] '''+''' 1 5-phospho-&alpha;-D-ribose 1-diphosphate[c] '''+''' 1 AMP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_4677]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_3025]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY0-662]], PRPP biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-662 PWY0-662]
 +
** '''1''' reactions found over '''1''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* RHEA:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7956 7956]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15609 15609]
* CAS : 108-80-5
+
* LIGAND-RXN:
* NCI:
+
** [http://www.genome.jp/dbget-bin/www_bget?R01049 R01049]
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=6284 6284]
+
* UNIPROT:
* HMDB : HMDB41861
+
** [http://www.uniprot.org/uniprot/Q63468 Q63468]
* LIGAND-CPD:
+
** [http://www.uniprot.org/uniprot/Q9CEI4 Q9CEI4]
** [http://www.genome.jp/dbget-bin/www_bget?C06554 C06554]
+
** [http://www.uniprot.org/uniprot/O67556 O67556]
* CHEMSPIDER:
+
** [http://www.uniprot.org/uniprot/P44328 P44328]
** [http://www.chemspider.com/Chemical-Structure.7668.html 7668]
+
** [http://www.uniprot.org/uniprot/Q9PP15 Q9PP15]
* CHEBI:
+
** [http://www.uniprot.org/uniprot/P56184 P56184]
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38028 38028]
+
** [http://www.uniprot.org/uniprot/P65235 P65235]
{{#set: smiles=C1(O)(=NC(O)=NC(O)=N1)}}
+
** [http://www.uniprot.org/uniprot/Q9CHB8 Q9CHB8]
{{#set: common name=cyanurate}}
+
** [http://www.uniprot.org/uniprot/P42816 P42816]
{{#set: inchi key=InChIKey=ZFSLODLOARCGLH-UHFFFAOYSA-N}}
+
** [http://www.uniprot.org/uniprot/Q59988 Q59988]
{{#set: molecular weight=129.075    }}
+
** [http://www.uniprot.org/uniprot/P14193 P14193]
{{#set: common name=cyanuric acid|2,4,6-trihydroxy-s-triazine|sym-triazine-2,4,6-triol|1,3,5-triazine-2,4,6-triol}}
+
** [http://www.uniprot.org/uniprot/P0A1V6 P0A1V6]
{{#set: consumed by=R468-RXN}}
+
** [http://www.uniprot.org/uniprot/P0A717 P0A717]
 +
** [http://www.uniprot.org/uniprot/P60891 P60891]
 +
** [http://www.uniprot.org/uniprot/P11908 P11908]
 +
** [http://www.uniprot.org/uniprot/P21108 P21108]
 +
** [http://www.uniprot.org/uniprot/P60892 P60892]
 +
** [http://www.uniprot.org/uniprot/P09330 P09330]
 +
** [http://www.uniprot.org/uniprot/P32895 P32895]
 +
** [http://www.uniprot.org/uniprot/Q59489 Q59489]
 +
** [http://www.uniprot.org/uniprot/P38620 P38620]
 +
** [http://www.uniprot.org/uniprot/P38063 P38063]
 +
** [http://www.uniprot.org/uniprot/P38689 P38689]
 +
** [http://www.uniprot.org/uniprot/Q42581 Q42581]
 +
** [http://www.uniprot.org/uniprot/P41831 P41831]
 +
** [http://www.uniprot.org/uniprot/P46585 P46585]
 +
** [http://www.uniprot.org/uniprot/Q42583 Q42583]
 +
** [http://www.uniprot.org/uniprot/Q14558 Q14558]
 +
** [http://www.uniprot.org/uniprot/Q55848 Q55848]
 +
** [http://www.uniprot.org/uniprot/Q49042 Q49042]
 +
** [http://www.uniprot.org/uniprot/O64888 O64888]
 +
** [http://www.uniprot.org/uniprot/Q680A5 Q680A5]
 +
** [http://www.uniprot.org/uniprot/Q93Z66 Q93Z66]
 +
{{#set: direction=REVERSIBLE}}
 +
{{#set: common name=ORF}}
 +
{{#set: ec number=EC-2.7.6.1}}
 +
{{#set: gene associated=Tiso_gene_4677|Tiso_gene_3025}}
 +
{{#set: in pathway=PWY0-662}}
 +
{{#set: reconstruction category=orthology|manual|annotation}}
 +
{{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis|manual-primary_network}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 19:08, 21 March 2018

Reaction PRPPSYN-RXN

  • direction:
    • REVERSIBLE
  • common name:
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ATP[c] + 1 D-ribose 5-phosphate[c] <=> 1 H+[c] + 1 5-phospho-α-D-ribose 1-diphosphate[c] + 1 AMP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY0-662, PRPP biosynthesis I: PWY0-662
    • 1 reactions found over 1 reactions in the full pathway

Reconstruction information

External links