Difference between revisions of "RXN1G-1435"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDROXYBENZOATE 2-3-DIHYDROXYBENZOATE] == * smiles: ** C(C1(=CC=CC(=C1O)O))([O-])=O * inc...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1435 RXN1G-1435] == * direction: ** LEFT-TO-RIGHT * common name: ** trehalose-phosphatase * e...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDROXYBENZOATE 2-3-DIHYDROXYBENZOATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1435 RXN1G-1435] ==
* smiles:
+
* direction:
** C(C1(=CC=CC(=C1O)O))([O-])=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=GLDQAMYCGOIJDV-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** 2,3-dihydroxybenzoate
+
** trehalose-phosphatase
* molecular weight:
+
* ec number:
** 153.114   
+
** [http://enzyme.expasy.org/EC/3.1.3.12 EC-3.1.3.12]
 
* Synonym(s):
 
* Synonym(s):
** 2,3-dihydroxybenzoic acid
 
** 3-hydroxysalicylate
 
** catechol-3-carboxylate
 
** 2-pyrocatechuate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[DHBDEHYD-RXN]]
+
** 1 [[CPD1G-768]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[CPD1G-1344]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 6-O-α-mycolyl-trehalose 6-phosphate[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 α, α'-trehalose 6-α-mycolate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10840]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14220]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 303-38-8
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=trehalose-phosphatase}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54675818 54675818]
+
{{#set: ec number=EC-3.1.3.12}}
* HMDB : HMDB00397
+
{{#set: gene associated=Tiso_gene_10840|Tiso_gene_14220}}
* LIGAND-CPD:
+
{{#set: in pathway=PWYG-321}}
** [http://www.genome.jp/dbget-bin/www_bget?C00196 C00196]
+
{{#set: reconstruction category=orthology|annotation}}
* CHEMSPIDER:
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
** [http://www.chemspider.com/Chemical-Structure.5323089.html 5323089]
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36654 36654]
+
* BIGG : 23dhb
+
{{#set: smiles=C(C1(=CC=CC(=C1O)O))([O-])=O}}
+
{{#set: inchi key=InChIKey=GLDQAMYCGOIJDV-UHFFFAOYSA-M}}
+
{{#set: common name=2,3-dihydroxybenzoate}}
+
{{#set: molecular weight=153.114    }}
+
{{#set: common name=2,3-dihydroxybenzoic acid|3-hydroxysalicylate|catechol-3-carboxylate|2-pyrocatechuate}}
+
{{#set: produced by=DHBDEHYD-RXN}}
+

Latest revision as of 20:08, 21 March 2018

Reaction RXN1G-1435

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trehalose-phosphatase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 6-O-α-mycolyl-trehalose 6-phosphate[c] + 1 H2O[c] => 1 phosphate[c] + 1 α, α'-trehalose 6-α-mycolate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links