Difference between revisions of "CPD-11690"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6538 PWY-6538] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11690 CPD-11690] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O * common name: ** 1-oleoyl...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11690 CPD-11690] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O |
* common name: | * common name: | ||
− | ** | + | ** 1-oleoyl-sn-glycerol |
+ | * inchi key: | ||
+ | ** InChIKey=RZRNAYUHWVFMIP-QJRAZLAKSA-N | ||
+ | * molecular weight: | ||
+ | ** 356.545 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** sn-glycerol 1-oleate |
+ | ** mono-oleoylglycerol | ||
+ | ** alpha-Monoolein | ||
+ | ** glycerol oleate | ||
+ | ** 1-oleylglycerol | ||
+ | ** 1-monoolein | ||
+ | ** mono-olein | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-15089]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http://www. | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12178130 12178130] |
− | * | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4446588.html 4446588] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75757 75757] |
− | {{#set: | + | * HMDB : HMDB11567 |
− | {{#set: | + | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O}} |
+ | {{#set: common name=1-oleoyl-sn-glycerol}} | ||
+ | {{#set: inchi key=InChIKey=RZRNAYUHWVFMIP-QJRAZLAKSA-N}} | ||
+ | {{#set: molecular weight=356.545 }} | ||
+ | {{#set: common name=sn-glycerol 1-oleate|mono-oleoylglycerol|alpha-Monoolein|glycerol oleate|1-oleylglycerol|1-monoolein|mono-olein}} | ||
+ | {{#set: consumed by=RXN-15089}} |
Latest revision as of 20:08, 21 March 2018
Contents
Metabolite CPD-11690
- smiles:
- CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O
- common name:
- 1-oleoyl-sn-glycerol
- inchi key:
- InChIKey=RZRNAYUHWVFMIP-QJRAZLAKSA-N
- molecular weight:
- 356.545
- Synonym(s):
- sn-glycerol 1-oleate
- mono-oleoylglycerol
- alpha-Monoolein
- glycerol oleate
- 1-oleylglycerol
- 1-monoolein
- mono-olein
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links