Difference between revisions of "CPD-11690"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIPOYL-AMP LIPOYL-AMP] == * smiles: ** C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11690 CPD-11690] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O * common name: ** 1-oleoyl...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11690 CPD-11690] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 1-oleoyl-sn-glycerol |
| + | * inchi key: | ||
| + | ** InChIKey=RZRNAYUHWVFMIP-QJRAZLAKSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 356.545 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** sn-glycerol 1-oleate |
| + | ** mono-oleoylglycerol | ||
| + | ** alpha-Monoolein | ||
| + | ** glycerol oleate | ||
| + | ** 1-oleylglycerol | ||
| + | ** 1-monoolein | ||
| + | ** mono-olein | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15089]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12178130 12178130] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4446588.html 4446588] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75757 75757] |
| − | + | * HMDB : HMDB11567 | |
| − | + | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O}} | |
| − | * HMDB : | + | {{#set: common name=1-oleoyl-sn-glycerol}} |
| − | {{#set: smiles= | + | {{#set: inchi key=InChIKey=RZRNAYUHWVFMIP-QJRAZLAKSA-N}} |
| − | {{#set: | + | {{#set: molecular weight=356.545 }} |
| − | {{#set: | + | {{#set: common name=sn-glycerol 1-oleate|mono-oleoylglycerol|alpha-Monoolein|glycerol oleate|1-oleylglycerol|1-monoolein|mono-olein}} |
| − | {{#set: molecular weight= | + | {{#set: consumed by=RXN-15089}} |
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 19:08, 21 March 2018
Contents
Metabolite CPD-11690
- smiles:
- CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O
- common name:
- 1-oleoyl-sn-glycerol
- inchi key:
- InChIKey=RZRNAYUHWVFMIP-QJRAZLAKSA-N
- molecular weight:
- 356.545
- Synonym(s):
- sn-glycerol 1-oleate
- mono-oleoylglycerol
- alpha-Monoolein
- glycerol oleate
- 1-oleylglycerol
- 1-monoolein
- mono-olein
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
