|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETALD-DEHYDROG-RXN ACETALD-DEHYDROG-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYNAPHTHOATE DIHYDROXYNAPHTHOATE] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** C([O-])(=O)C1(=C(O)C2(=C(C(O)=C1)C=CC=C2)) |
| * common name: | | * common name: |
− | ** ORF | + | ** 2-carboxy-1,4-naphthoquinol |
− | * ec number: | + | * inchi key: |
− | ** [http://enzyme.expasy.org/EC/1.2.1.10 EC-1.2.1.10] | + | ** InChIKey=VOJUXHHACRXLTD-UHFFFAOYSA-M |
| + | * molecular weight: |
| + | ** 203.174 |
| * Synonym(s): | | * Synonym(s): |
| + | ** DHNA |
| + | ** 1,4-dihydroxy-2-naphthoate |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[R06858]] |
− | ** 1 [[CO-A]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[ACETALD]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[ACETYL-COA]][c] '''+''' 1 [[NADH]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 coenzyme A[c] '''+''' 1 NAD+[c] '''+''' 1 acetaldehyde[c] '''<=>''' 1 H+[c] '''+''' 1 acetyl-CoA[c] '''+''' 1 NADH[c]
| + | |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_7649]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_2052]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | == Pathways ==
| + | |
− | * [[PWY-5436]], L-threonine degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5436 PWY-5436]
| + | |
− | ** '''2''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[PWY-7180]], 2'-deoxy-α-D-ribose 1-phosphate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7180 PWY-7180]
| + | |
− | ** '''1''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-5162]], 2-oxopentenoate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5162 PWY-5162]
| + | |
− | ** '''1''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-7085]], triethylamine degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7085 PWY-7085] | + | |
− | ** '''1''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[FERMENTATION-PWY]], mixed acid fermentation: [http://metacyc.org/META/NEW-IMAGE?object=FERMENTATION-PWY FERMENTATION-PWY]
| + | |
− | ** '''9''' reactions found over '''16''' reactions in the full pathway
| + | |
− | * [[PHOSPHONOTASE-PWY]], 2-aminoethylphosphonate degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHONOTASE-PWY PHOSPHONOTASE-PWY]
| + | |
− | ** '''1''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[P122-PWY]], heterolactic fermentation: [http://metacyc.org/META/NEW-IMAGE?object=P122-PWY P122-PWY]
| + | |
− | ** '''14''' reactions found over '''18''' reactions in the full pathway
| + | |
− | * [[P161-PWY]], acetylene degradation: [http://metacyc.org/META/NEW-IMAGE?object=P161-PWY P161-PWY]
| + | |
− | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[ETOH-ACETYLCOA-ANA-PWY]], ethanol degradation I: [http://metacyc.org/META/NEW-IMAGE?object=ETOH-ACETYLCOA-ANA-PWY ETOH-ACETYLCOA-ANA-PWY]
| + | |
− | ** '''2''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[PWY4LZ-257]], superpathway of fermentation (Chlamydomonas reinhardtii): [http://metacyc.org/META/NEW-IMAGE?object=PWY4LZ-257 PWY4LZ-257]
| + | |
− | ** '''5''' reactions found over '''13''' reactions in the full pathway
| + | |
− | * [[PWY-5480]], pyruvate fermentation to ethanol I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5480 PWY-5480]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-6587]], pyruvate fermentation to ethanol III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6587 PWY-6587]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23288 23288] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54706667 54706667] |
− | * LIGAND-RXN: | + | * CHEMSPIDER: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00228 R00228] | + | ** [http://www.chemspider.com/Chemical-Structure.5324583.html 5324583] |
− | * UNIPROT:
| + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/Q52434 Q52434]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=11173 11173] |
− | ** [http://www.uniprot.org/uniprot/P0A9Q7 P0A9Q7] | + | * BIGG : dhna |
− | ** [http://www.uniprot.org/uniprot/P77580 P77580] | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P71866 P71866]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C03657 C03657] |
− | ** [http://www.uniprot.org/uniprot/Q52060 Q52060] | + | {{#set: smiles=C([O-])(=O)C1(=C(O)C2(=C(C(O)=C1)C=CC=C2))}} |
− | ** [http://www.uniprot.org/uniprot/Q52016 Q52016] | + | {{#set: common name=2-carboxy-1,4-naphthoquinol}} |
− | ** [http://www.uniprot.org/uniprot/O85978 O85978] | + | {{#set: inchi key=InChIKey=VOJUXHHACRXLTD-UHFFFAOYSA-M}} |
− | {{#set: direction=REVERSIBLE}} | + | {{#set: molecular weight=203.174 }} |
− | {{#set: common name=ORF}} | + | {{#set: common name=DHNA|1,4-dihydroxy-2-naphthoate}} |
− | {{#set: ec number=EC-1.2.1.10}}
| + | {{#set: consumed by=R06858}} |
− | {{#set: gene associated=Tiso_gene_7649|Tiso_gene_2052}} | + | |
− | {{#set: in pathway=PWY-5436|PWY-7180|PWY-5162|PWY-7085|FERMENTATION-PWY|PHOSPHONOTASE-PWY|P122-PWY|P161-PWY|ETOH-ACETYLCOA-ANA-PWY|PWY4LZ-257|PWY-5480|PWY-6587}}
| + | |
− | {{#set: reconstruction category=orthology|annotation}} | + | |
− | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-creinhardtii}} | + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}} | + | |