Difference between revisions of "DIHYDROXYNAPHTHOATE"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7686 PWY-7686] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYNAPHTHOATE DIHYDROXYNAPHTHOATE] == * smiles: ** C([O-])(=O)C1(=C(O)C2(=C(C(O)=C1)C=CC=...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYNAPHTHOATE DIHYDROXYNAPHTHOATE] == |
− | * | + | * smiles: |
− | ** [ | + | ** C([O-])(=O)C1(=C(O)C2(=C(C(O)=C1)C=CC=C2)) |
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 2-carboxy-1,4-naphthoquinol |
+ | * inchi key: | ||
+ | ** InChIKey=VOJUXHHACRXLTD-UHFFFAOYSA-M | ||
+ | * molecular weight: | ||
+ | ** 203.174 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** DHNA |
+ | ** 1,4-dihydroxy-2-naphthoate | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[R06858]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54706667 54706667] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.5324583.html 5324583] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=11173 11173] |
+ | * BIGG : dhna | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03657 C03657] | ||
+ | {{#set: smiles=C([O-])(=O)C1(=C(O)C2(=C(C(O)=C1)C=CC=C2))}} | ||
+ | {{#set: common name=2-carboxy-1,4-naphthoquinol}} | ||
+ | {{#set: inchi key=InChIKey=VOJUXHHACRXLTD-UHFFFAOYSA-M}} | ||
+ | {{#set: molecular weight=203.174 }} | ||
+ | {{#set: common name=DHNA|1,4-dihydroxy-2-naphthoate}} | ||
+ | {{#set: consumed by=R06858}} |
Latest revision as of 20:08, 21 March 2018
Contents
Metabolite DIHYDROXYNAPHTHOATE
- smiles:
- C([O-])(=O)C1(=C(O)C2(=C(C(O)=C1)C=CC=C2))
- common name:
- 2-carboxy-1,4-naphthoquinol
- inchi key:
- InChIKey=VOJUXHHACRXLTD-UHFFFAOYSA-M
- molecular weight:
- 203.174
- Synonym(s):
- DHNA
- 1,4-dihydroxy-2-naphthoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C1(=C(O)C2(=C(C(O)=C1)C=CC=C2))" cannot be used as a page name in this wiki.